PPIRE00943
Target Protein Information
| Protein_Name | Galanin receptor type 1 |
|---|---|
| Protein_Sequence | MELAPVNLSEGNGSDPEPPAEPRPLFGIGVENFITLVVFGLIFAMGVLGNSLVITVLARSKPGKPRSTTNLFILNLSIADLAYLLFCIPFQATVYALPTWVLGAFICKFIHYFFTVSMLVSIFTLAAMSVDRYVAIVHSRRSSSLRVSRNALLGVGFIWALSIAMASPVAYYQRLFHRDSNQTFCWEHWPNQLHKKAYVVCTFVFGYLLPLLLICFCYAKVLNHLHKKLKNMSKKSEASKKKTAQTVLVVVVVFGISWLPHHVIHLWAEFGAFPLTPASFFFRITAHCLAYSNSSVNPIIYAFLSENFRKAYKQVFKCRVCNESPHGDAKEKNRIDTPPSTNCTHV |
| Organism_Source | Rattus norvegicus |
| Functional_Classification | G protein-coupled receptor |
| Cellular_Localization | plasma membrane |
| Gene_Names | Galr1 |
| UniProt_ID | Q62805 |
| Protein-Protein Interaction Networks | |
Peptide Basic Information
| Peptide_Name | Galanin |
|---|---|
| Peptide_Sequence | GWTLNSAGYLLGPHAKLSLTTGISQEKYI |
| Peptide_Length | 29 |
| Peptide_SMILES | CC[C@H](C)[C@H](NC(=O)[C@H](Cc1ccc(O)cc1)NC(=O)[C@H](CCCCN)NC(=O)[C@H](CCC(=O)O)NC(=O)[C@H](CCC(N)=O)NC(=O)[C@H](CO)NC(=O)[C@@H](NC(=O)CNC(=O)[C@@H](NC(=O)[C@@H](NC(=O)[C@H](CC(C)C)NC(=O)[C@H](CO)NC(=O)[C@H](CC(C)C)NC(=O)[C@H](CCCCN)NC(=O)[C@H](C)NC(=O)[C@H](Cc1c[nH]cn1)NC(=O)[C@@H]1CCCN1C(=O)CNC(=O)[C@H](CC(C)C)NC(=O)[C@H](CC(C)C)NC(=O)[C@H](Cc1ccc(O)cc1)NC(=O)CNC(=O)[C@H](C)NC(=O)[C@H](CO)NC(=O)[C@H](CC(N)=O)NC(=O)[C@H](CC(C)C)NC(=O)[C@@H](NC(=O)[C@H](Cc1c[nH]c2ccccc12)NC(=O)CN)[C@@H](C)O)[C@@H](C)O)[C@@H](C)O)[C@@H](C)CC)C(=O)O |
| Chemical_Modification | None |
| Cyclization_Method | None |
| Linear/Cyclic | Linear |
| N-terminal_Modification | Free |
| C-terminal_Modification | Free |
| Amino_Acid_Distribution | |
|
|
|
Peptide Physicochemical
| Molecular_Weight | 3119.57 |
|---|---|
| Aliphatic_Index | 101.03448 |
| Aromaticity | 0.10345 |
| Average_Rotatable_Bonds | 3.44828 |
| Charge_at_pH_7 | 1.08838 |
| Isoelectric_Point | 9.12426 |
|---|---|
| Hydrogen_Bond_Acceptors | 44 |
| Hydrogen_Bond_Donors | 44 |
| Topological_Polar_Surface_Area | 1251.16000 |
| X_logP_energy | -11.66360 |
Interaction Information
| Affinity | IC50=7 nM |
|---|---|
| Affinity_Assay | Enzyme Inhibition Kinetics |
| PDB_ID | None |
| Type | Agonist |
| Structure | |
Reference Information
| Document_Type | Research Articles |
|---|---|
| Title | Evidence for an inhibitory effect of the peptide galanin on dopamine release from the rat median eminence. |
| Release_Year | 1987 |
| PMID | 2436097 |
| DOI | 10.1016/0304-3940(87)90024-3 |