PPIRE00991
Target Protein Information
| Protein_Name | Substance-P receptor |
|---|---|
| Protein_Sequence | MDNVLPVDSDLFPNTSTNTSESNQFVQPTWQIVLWAAAYTVIVVTSVVGNVVVIWIILAHKRMRTVTNYFLVNLAFAEACMAAFNTVVNFTYAVHNVWYYGLFYCKFHNFFPIAALFASIYSMTAVAFDRYMAIIHPLQPRLSATATKVVIFVIWVLALLLAFPQGYYSTTETMPSRVVCMIEWPEHPNRTYEKAYHICVTVLIYFLPLLVIGYAYTVVGITLWASEIPGDSSDRYHEQVSAKRKVVKMMIVVVCTFAICWLPFHIFFLLPYINPDLYLKKFIQQVYLASMWLAMSSTMYNPIIYCCLNDRFRLGFKHAFRCCPFISAGDYEGLEMKSTRYLQTQSSVYKVSRLETTISTVVGAHEDEPEEGPKATPSSLDLTSNGSSRSNSKTMTESSSFYSNMLA |
| Organism_Source | Mus musculus |
| Functional_Classification | G protein-coupled receptor |
| Cellular_Localization | plasma membrane |
| Gene_Names | Tacr1 |
| UniProt_ID | P30548 |
| Protein-Protein Interaction Networks | |
Peptide Basic Information
| Peptide_Name | bufokinin |
|---|---|
| Peptide_Sequence | KPRPDQFYGLM |
| Peptide_Length | 11 |
| Peptide_SMILES | CSCC[C@H](NC(=O)[C@H](CC(C)C)NC(=O)CNC(=O)[C@H](Cc1ccc(O)cc1)NC(=O)[C@H](Cc1ccccc1)NC(=O)[C@H](CCC(N)=O)NC(=O)[C@H](CC(=O)O)NC(=O)[C@@H]1CCCN1C(=O)[C@H](CCCNC(=N)N)NC(=O)[C@@H]1CCCN1C(=O)[C@@H](N)CCCCN)C(=O)O |
| Chemical_Modification | None |
| Cyclization_Method | None |
| Linear/Cyclic | Linear |
| N-terminal_Modification | Free |
| C-terminal_Modification | amide |
| Amino_Acid_Distribution | |
|
|
|
Peptide Physicochemical
| Molecular_Weight | 1351.59 |
|---|---|
| Aliphatic_Index | 35.45455 |
| Aromaticity | 0.18182 |
| Average_Rotatable_Bonds | 3.72727 |
| Charge_at_pH_7 | 0.99728 |
| Isoelectric_Point | 9.29736 |
|---|---|
| Hydrogen_Bond_Acceptors | 18 |
| Hydrogen_Bond_Donors | 17 |
| Topological_Polar_Surface_Area | 525.28000 |
| X_logP_energy | -2.98723 |
Interaction Information
| Affinity | KD=0.57 nM |
|---|---|
| Affinity_Assay | radioligand saturation binding assay |
| PDB_ID | None |
| Type | Agonist |
| Structure | |
Reference Information
| Document_Type | Research Articles |
|---|---|
| Title | Pharmacological and biochemical investigation of receptors for the toad gut tachykinin peptide, bufokinin, in its species of origin. |
| Release_Year | 1999 |
| PMID | 10494889 |
| DOI | 10.1007/s002109900069 |