PPIRE01064
Target Protein Information
| Protein_Name | Importin subunit alpha-1 |
|---|---|
| Protein_Sequence | MSTNENANLPAARLNRFKNKGKDSTEMRRRRIEVNVELRKAKKDEQMLKRRNVSSFPDDATSPLQENRNNQGTVNWSVEDIVKGINSNNLESQLQATQAARKLLSREKQPPIDNIIRAGLIPKFVSFLGKTDCSPIQFESAWALTNIASGTSEQTKAVVDGGAIPAFISLLASPHAHISEQAVWALGNIAGDGSAFRDLVIKHGAIDPLLALLAVPDLSTLACGYLRNLTWTLSNLCRNKNPAPPLDAVEQILPTLVRLLHHNDPEVLADSCWAISYLTDGPNERIEMVVKKGVVPQLVKLLGATELPIVTPALRAIGNIVTGTDEQTQKVIDAGALAVFPSLLTNPKTNIQKEATWTMSNITAGRQDQIQQVVNHGLVPFLVGVLSKADFKTQKEAAWAITNYTSGGTVEQIVYLVHCGIIEPLMNLLSAKDTKIIQVILDAISNIFQAAEKLGETEKLSIMIEECGGLDKIEALQRHENESVYKASLNLIEKYFSVEEEEDQNVVPETTSEGFAFQVQDGAPGTFNF |
| Organism_Source | Mus musculus |
| Functional_Classification | nuclear transport receptor |
| Cellular_Localization | Cytoplasm |
| Gene_Names | Kpna2 |
| UniProt_ID | P52293 |
| Protein-Protein Interaction Networks | |
Peptide Basic Information
| Peptide_Name | TNRC6A nuclear localisation signal peptide |
|---|---|
| Peptide_Sequence | SGKKRRRER |
| Peptide_Length | 9 |
| Peptide_SMILES | N=C(N)NCCC[C@H](NC(=O)[C@H](CCC(=O)O)NC(=O)[C@H](CCCNC(=N)N)NC(=O)[C@H](CCCNC(=N)N)NC(=O)[C@H](CCCNC(=N)N)NC(=O)[C@H](CCCCN)NC(=O)[C@H](CCCCN)NC(=O)CNC(=O)[C@@H](N)CO)C(=O)O |
| Chemical_Modification | None |
| Cyclization_Method | None |
| Linear/Cyclic | Linear |
| N-terminal_Modification | Free |
| C-terminal_Modification | Free |
| Amino_Acid_Distribution | |
|
|
|
Peptide Physicochemical
| Molecular_Weight | 1172.36 |
|---|---|
| Aliphatic_Index | 0.00000 |
| Aromaticity | 0.00000 |
| Average_Rotatable_Bonds | 5.00000 |
| Charge_at_pH_7 | 4.99916 |
| Isoelectric_Point | 12.51643 |
|---|---|
| Hydrogen_Bond_Acceptors | 18 |
| Hydrogen_Bond_Donors | 26 |
| Topological_Polar_Surface_Area | 653.29000 |
| X_logP_energy | -8.92372 |
Interaction Information
| Affinity | KD=75.62 nM |
|---|---|
| Affinity_Assay | solid phase binding assay |
| PDB_ID | 5UMZ |
| Type | Affinity ligand |
| Structure | |
Reference Information
| Document_Type | Research Articles |
|---|---|
| Title | Structural characterisation of TNRC6A nuclear localisation signal in complex with importin-alpha. |
| Release_Year | 2017 |
| PMID | 28837617 |
| DOI | 10.1371/journal.pone.0183587 |