PPIRE01497
Target Protein Information
| Protein_Name | None |
|---|---|
| Protein_Sequence | MSVQRALHYYLCSQLLLHLYAVEGSYHERRLYEDLMRDYNNLERPVANHSQPVTVYLKVSLQQIIDVDEKNQIVYVNAWLDYAWNDYKLRWDKEEYGNITDVRFPAGKIWKPDVLLYNSVDANFDSTYPTNMVVYNTGDISWIPPGIFKISCKIDIKWFPFDEQRCFFKFGSWTYDGFKLDLQPGKGGFDISEYMPSGEWALPMTTVSRTEKFYDCCPEPYPDLTFYLHMRRRTLYYGFNLIMPCILTTMMTLLGFTLPPDAGEKITLQITVLLSICFFLSIVSEISPPTSEAVPLLGIFFSCCMIVVTASTVFTVYVLNLHYRTPETHEMGITTRTLLLYWFPYILRMERPGVYLTWQTLPPLFPCSKPKKHSESLIRNVKDVETGSSRSNSLDVERRVHQYMSGLTNGTGAPMCTVLNGGPATVAGAPMDIGQQATLLVLQRIYQELKTITRRMIEADREGAQSNNWKFAAMVVDRLCLYVFTVFIVASSCGILLSAPYTIA |
| Organism_Source | Ascaris suum |
| Functional_Classification | ligand-gated ion channels |
| Cellular_Localization | plasma membrane |
| Gene_Names | acr-16 |
| UniProt_ID | A0A0K0QSL7 |
| Protein-Protein Interaction Networks | |
Peptide Basic Information
| Peptide_Name | NLP-2A |
|---|---|
| Peptide_Sequence | PRFGQRGYAMSa |
| Peptide_Length | 12 |
| Peptide_SMILES | CSCC[C@H](NC(=O)[C@H](C)NC(=O)[C@H](Cc1ccc(O)cc1)NC(=O)CNC(=O)[C@H](CCCNC(=N)N)NC(=O)[C@H](CCC(N)=O)NC(=O)CNC(=O)[C@H](Cc1ccccc1)NC(=O)[C@H](CCCNC(=N)N)NC(=O)[C@@H]1CCCN1)C(=O)N[C@@H](CO)C(=O)N[C@@H](C)C(=O)O |
| Chemical_Modification | None |
| Cyclization_Method | None |
| Linear/Cyclic | Linear |
| N-terminal_Modification | Free |
| C-terminal_Modification | amide |
| Amino_Acid_Distribution | |
|
|
|
Peptide Physicochemical
| Molecular_Weight | 1340.52 |
|---|---|
| Aliphatic_Index | 16.66667 |
| Aromaticity | 0.16667 |
| Average_Rotatable_Bonds | 3.50000 |
| Charge_at_pH_7 | 1.99713 |
| Isoelectric_Point | 11.14762 |
|---|---|
| Hydrogen_Bond_Acceptors | 19 |
| Hydrogen_Bond_Donors | 22 |
| Topological_Polar_Surface_Area | 576.78000 |
| X_logP_energy | -6.81316 |
Interaction Information
| Affinity | IC50=78 uM |
|---|---|
| Affinity_Assay | organ bath contraction assay |
| PDB_ID | None |
| Type | antagonist |
| Structure | |
Reference Information
| Document_Type | Research Articles |
|---|---|
| Title | The actions of Caenorhabditis elegans neuropeptide-like peptides (NLPs)on body wall muscle of Ascaris suum and pharyngeal muscle of C. elegans. |
| Release_Year | 2008 |
| PMID | 18652392 |
| DOI | 10.1556/ABiol.59.2008.Suppl.28 |