PPIRE02677
Target Protein Information
| Protein_Name | Interleukin-8 |
|---|---|
| Protein_Sequence | MTSKLAVALLAAFLISAALCEGAVLPRSAKELRCQCIKTYSKPFHPKFIKELRVIESGPHCANTEIIVKLSDGRELCLDPKENWVQRVVEKFLKRAENS |
| Organism_Source | Homo sapiens |
| Functional_Classification | Immune-related protein |
| Cellular_Localization | Extracellular |
| Gene_Names | CXCL8 |
| UniProt_ID | P10145 |
| Protein-Protein Interaction Networks | |
Peptide Basic Information
| Peptide_Name | IL8[12?20] |
|---|---|
| Peptide_Sequence | TYSKPFHPK |
| Peptide_Length | 9 |
| Peptide_SMILES | C[C@@H](O)[C@H](N)C(=O)N[C@@H](Cc1ccc(O)cc1)C(=O)N[C@@H](CO)C(=O)N[C@@H](CCCCN)C(=O)N1CCC[C@H]1C(=O)N[C@@H](Cc1ccccc1)C(=O)N[C@@H](Cc1c[nH]cn1)C(=O)N1CCC[C@H]1C(=O)N[C@@H](CCCCN)C(=O)O |
| Chemical_Modification | None |
| Cyclization_Method | None |
| Linear/Cyclic | Linear |
| N-terminal_Modification | Free |
| C-terminal_Modification | Free |
| Amino_Acid_Distribution | |
|
|
|
Peptide Physicochemical
| Molecular_Weight | 1104.27 |
|---|---|
| Aliphatic_Index | 0.00000 |
| Aromaticity | 0.22222 |
| Average_Rotatable_Bonds | 3.44444 |
| Charge_at_pH_7 | 2.08745 |
| Isoelectric_Point | 10.24774 |
|---|---|
| Hydrogen_Bond_Acceptors | 16 |
| Hydrogen_Bond_Donors | 14 |
| Topological_Polar_Surface_Area | 419.95000 |
| X_logP_energy | -2.92300 |
Interaction Information
| Affinity | KD=80 uM |
|---|---|
| Affinity_Assay | Surface plasmon resonance |
| PDB_ID | None |
| Type | Inhibitor |
| Structure | |
Reference Information
| Document_Type | Research Articles |
|---|---|
| Title | Epitope Identification and Affinity Determination of an Inhibiting Human Antibody to Interleukin IL8 (CXCL8)by SPR- Biosensor-Mass Spectrometry Combination. |
| Release_Year | 2020 |
| PMID | 32881511 |
| DOI | 10.1021/jasms.9b00050 |