PPIRE02680
Target Protein Information
| Protein_Name | Major prion protein |
|---|---|
| Protein_Sequence | MANLGCWMLVLFVATWSDLGLCKKRPKPGGWNTGGSRYPGQGSPGGNRYPPQGGGGWGQPHGGGWGQPHGGGWGQPHGGGWGQPHGGGWGQGGGTHSQWNKPSKPKTNMKHMAGAAAAGAVVGGLGGYMLGSAMSRPIIHFGSDYEDRYYRENMHRYPNQVYYRPMDEYSNQNNFVHDCVNITIKQHTVTTTTKGENFTETDVKMMERVVEQMCITQYERESQAYYQRGSSMVLFSSPPVILLISFLIFLIVG |
| Organism_Source | Homo sapiens |
| Functional_Classification | GPI-anchored membrane proteins |
| Cellular_Localization | Plasma membrane |
| Gene_Names | PRNP |
| UniProt_ID | P04156 |
| Protein-Protein Interaction Networks | |
Peptide Basic Information
| Peptide_Name | PrP(23-28,57-98) |
|---|---|
| Peptide_Sequence | KKRPKPWGQPHGGGWGQPHGGGWGQPHGGGWGQPHGGGWGQGGGTHNQ |
| Peptide_Length | 48 |
| Peptide_SMILES | C[C@@H](O)[C@H](NC(=O)CNC(=O)CNC(=O)CNC(=O)[C@H](CCC(N)=O)NC(=O)CNC(=O)[C@H](Cc1c[nH]c2ccccc12)NC(=O)CNC(=O)CNC(=O)CNC(=O)[C@H](Cc1c[nH]cn1)NC(=O)[C@@H]1CCCN1C(=O)[C@H](CCC(N)=O)NC(=O)CNC(=O)[C@H](Cc1c[nH]c2ccccc12)NC(=O)CNC(=O)CNC(=O)CNC(=O)[C@H](Cc1c[nH]cn1)NC(=O)[C@@H]1CCCN1C(=O)[C@H](CCC(N)=O)NC(=O)CNC(=O)[C@H](Cc1c[nH]c2ccccc12)NC(=O)CNC(=O)CNC(=O)CNC(=O)[C@H](Cc1c[nH]cn1)NC(=O)[C@@H]1CCCN1C(=O)[C@H](CCC(N)=O)NC(=O)CNC(=O)[C@H](Cc1c[nH]c2ccccc12)NC(=O)CNC(=O)CNC(=O)CNC(=O)[C@H](Cc1c[nH]cn1)NC(=O)[C@@H]1CCCN1C(=O)[C@H](CCC(N)=O)NC(=O)CNC(=O)[C@H](Cc1c[nH]c2ccccc12)NC(=O)[C@@H]1CCCN1C(=O)[C@H](CCCCN)NC(=O)[C@@H]1CCCN1C(=O)[C@H](CCCNC(=N)N)NC(=O)[C@H](CCCCN)NC(=O)[C@@H](N)CCCCN)C(=O)N[C@@H](Cc1c[nH]cn1)C(=O)N[C@@H](CC(N)=O)C(=O)N[C@@H](CCC(N)=O)C(=O)O |
| Chemical_Modification | None |
| Cyclization_Method | None |
| Linear/Cyclic | Linear |
| N-terminal_Modification | Acetyl |
| C-terminal_Modification | amide |
| Amino_Acid_Distribution | |
|
|
|
Peptide Physicochemical
| Molecular_Weight | 4883.23 |
|---|---|
| Aliphatic_Index | 0.00000 |
| Aromaticity | 0.10417 |
| Average_Rotatable_Bonds | 3.04167 |
| Charge_at_pH_7 | 4.45164 |
| Isoelectric_Point | 11.92453 |
|---|---|
| Hydrogen_Bond_Acceptors | 66 |
| Hydrogen_Bond_Donors | 67 |
| Topological_Polar_Surface_Area | 2062.45000 |
| X_logP_energy | -27.20243 |
Interaction Information
| Affinity | KD=380 nM |
|---|---|
| Affinity_Assay | Isothermal titration calorimetry |
| PDB_ID | None |
| Type | Affinity ligand |
| Structure | |
Reference Information
| Document_Type | Research Articles |
|---|---|
| Title | Calorimetric investigation of copper binding in the N-terminal region of the prion protein at low copper loading: evidence for an entropically favorable first binding event. |
| Release_Year | 2014 |
| PMID | 25541747 |
| DOI | 10.1021/ic502014x |