PPIRE02837
Target Protein Information
| Protein_Name | Macrophage scavenger receptor types I and II |
|---|---|
| Protein_Sequence | MTKEMTENQRLCPHEQEDADCSSESVKFDARSMTASLPHSTKNGPSLQEKLKSFKAALIALYLLVFAVLIPVVGIVTAQLLNWEMKNCLVCSLNTSDTSQGPMEKENTSKVEMRFTIIMEHMKDMEERIESISNSKADLIDTERFQNFSMATDQRLNDILLQLNSLISSVQEHGNSLDAISKSLQSLNMTLLDVQLHTETLNVRVRESTAKQQEDISKLEERVYKVSAEVQSVKEEQAHVEQEVKQEVRVLNNITNDLRLKDWEHSQTLKNITFIQGPPGPQGEKGDRGLTGQTGPPGAPGIRGIPGVKGDRGQIGFPGGRGNPGAPGKPGRSGSPGPKGQKGEKGSVGGSTPLKTVRLVGGSGAHEGRVEIFHQGQWGTICDDRWDIRAGQVVCRSLGYQEVLAVHKRAHFGQGTGPIWLNEVMCFGRESSIENCKINQWGVLSCSHSEDAGVTCTS |
| Organism_Source | Mus musculus |
| Functional_Classification | receptor |
| Cellular_Localization | Plasma membrane |
| Gene_Names | Msr1 |
| UniProt_ID | P30204 |
| Protein-Protein Interaction Networks | |
Peptide Basic Information
| Peptide_Name | PEG5kDa-Cys-Tyr-(Leu-Arg)8 |
|---|---|
| Peptide_Sequence | CYLRLRLRLRLRLRLRLR |
| Peptide_Length | 18 |
| Peptide_SMILES | CC(C)C[C@H](NC(=O)[C@H](CCCNC(=N)N)NC(=O)[C@H](CC(C)C)NC(=O)[C@H](CCCNC(=N)N)NC(=O)[C@H](CC(C)C)NC(=O)[C@H](CCCNC(=N)N)NC(=O)[C@H](CC(C)C)NC(=O)[C@H](CCCNC(=N)N)NC(=O)[C@H](CC(C)C)NC(=O)[C@H](CCCNC(=N)N)NC(=O)[C@H](CC(C)C)NC(=O)[C@H](CCCNC(=N)N)NC(=O)[C@H](CC(C)C)NC(=O)[C@H](CCCNC(=N)N)NC(=O)[C@H](CC(C)C)NC(=O)[C@H](Cc1ccc(O)cc1)NC(=O)[C@@H](N)CS)C(=O)N[C@@H](CCCNC(=N)N)C(=O)O |
| Chemical_Modification | None |
| Cyclization_Method | None |
| Linear/Cyclic | Linear |
| N-terminal_Modification | Free |
| C-terminal_Modification | Free |
| Amino_Acid_Distribution | |
|
|
|
Peptide Physicochemical
| Molecular_Weight | 2439.11 |
|---|---|
| Aliphatic_Index | 173.33333 |
| Aromaticity | 0.05556 |
| Average_Rotatable_Bonds | 4.77778 |
| Charge_at_pH_7 | 7.93513 |
| Isoelectric_Point | 12.72243 |
|---|---|
| Hydrogen_Bond_Acceptors | 29 |
| Hydrogen_Bond_Donors | 45 |
| Topological_Polar_Surface_Area | 1073.45000 |
| X_logP_energy | -6.00704 |
Interaction Information
| Affinity | IC50=15 uM |
|---|---|
| Affinity_Assay | NMR chemical shift perturbation |
| PDB_ID | None |
| Type | Affinity ligand |
| Structure | |
Reference Information
| Document_Type | Research Articles |
|---|---|
| Title | PEG-Peptide Inhibition of Scavenger Receptor Uptake of Nanoparticles by the Liver. |
| Release_Year | 2018 |
| PMID | 30052459 |
| DOI | 10.1021/acs.molpharmaceut.8b00355 |