PPIRE03023
Target Protein Information
| Protein_Name | Neutrophil cytosol factor 1 |
|---|---|
| Protein_Sequence | MGDTFIRHIALLGFEKRFVPSQHYVYMFLVKWQDLSEKVVYRRFTEIYEFHKTLKEMFPIEAGAINPENRIIPHLPAPKWFDGQRAAENRQGTLTEYCSTLMSLPTKISRCPHLLDFFKVRPDDLKLPTDNQTKKPETYLMPKDGKSTATDITGPIILQTYRAIANYEKTSGSEMALSTGDVVEVVEKSESGWWFCQMKAKRGWIPASFLEPLDSPDETEDPEPNYAGEPYVAIKAYTAVEGDEVSLLEGEAVEVIHKLLDGWWVIRKDDVTGYFPSMYLQKSGQDVSQAQRQIKRGAPPRRSSIRNAHSIHQRSRKRLSQDAYRRNSVRFLQQRRRQARPGPQSPGSPLEEERQTQRSKPQPAVPPRPSADLILNRCSESTKRKLASAV |
| Organism_Source | Homo sapiens |
| Functional_Classification | Immune-related protein |
| Cellular_Localization | Cytoplasm |
| Gene_Names | NCF1 |
| UniProt_ID | P14598 |
| Protein-Protein Interaction Networks | |
Peptide Basic Information
| Peptide_Name | peptide2 |
|---|---|
| Peptide_Sequence | RGAPPRRSS |
| Peptide_Length | 9 |
| Peptide_SMILES | C[C@H](NC(=O)CNC(=O)[C@@H](N)CCCNC(=N)N)C(=O)N1CCC[C@H]1C(=O)N1CCC[C@H]1C(=O)N[C@@H](CCCNC(=N)N)C(=O)N[C@@H](CCCNC(=N)N)C(=O)N[C@@H](CO)C(=O)N[C@@H](CO)C(=O)O |
| Chemical_Modification | None |
| Cyclization_Method | None |
| Linear/Cyclic | Linear |
| N-terminal_Modification | Free |
| C-terminal_Modification | Free |
| Amino_Acid_Distribution | |
|
|
|
Peptide Physicochemical
| Molecular_Weight | 983.10 |
|---|---|
| Aliphatic_Index | 11.11111 |
| Aromaticity | 0.00000 |
| Average_Rotatable_Bonds | 3.22222 |
| Charge_at_pH_7 | 2.99797 |
| Isoelectric_Point | 12.80107 |
|---|---|
| Hydrogen_Bond_Acceptors | 15 |
| Hydrogen_Bond_Donors | 19 |
| Topological_Polar_Surface_Area | 504.70000 |
| X_logP_energy | -8.28519 |
Interaction Information
| Affinity | KD=29 uM |
|---|---|
| Affinity_Assay | Isothermal titration calorimetry |
| PDB_ID | 1NG2 |
| Type | Affinity ligand |
| Structure | |
Reference Information
| Document_Type | Research Articles |
|---|---|
| Title | Molecular basis of phosphorylation-induced activation of the NADPH oxidase |
| Release_Year | 2003 |
| PMID | 12732142 |
| DOI | 10.1016/s0092-8674(03)00314-3 |