PPIRE03389
Target Protein Information
| Protein_Name | Adrenocorticotropic hormone receptor |
|---|---|
| Protein_Sequence | NLIVLLAVIKNKNLQSPVYFFICSLAISDMLGSLYKILENILIMFRNMGYLKPRGSLESTADDIIDCMFVLSLLGSIFSLSVIAADRYITIFHALQYHSIVTMRRTVITLTVIWMFCTGSGITMVIFSHHIPTVLTFTSLFPLMLVFILCLYIHMFLLARSHARKISTLPRANMKGAMTLTILLGVFIFCWAPFVLHVLLMTFCPNNPYCVCYMSLFQVNGMLIMCNAVIDPFIYAFRSPEQ |
| Organism_Source | Rattus norvegicus |
| Functional_Classification | Receptor |
| Cellular_Localization | Plasma membrane |
| Gene_Names | Mc2r |
| UniProt_ID | Q8CIX6 |
| Protein-Protein Interaction Networks | |
Peptide Basic Information
| Peptide_Name | R-4 |
|---|---|
| Peptide_Sequence | VTCYCRRTRCGFRERLSGACGYRGRIVTCYCRSTRCGF |
| Peptide_Length | 38 |
| Peptide_SMILES | CC[C@H](C)[C@H](NC(=O)[C@H](CCCNC(=N)N)NC(=O)CNC(=O)[C@H](CCCNC(=N)N)NC(=O)[C@H](Cc1ccc(O)cc1)NC(=O)CNC(=O)[C@H](CS)NC(=O)[C@H](C)NC(=O)CNC(=O)[C@H](CO)NC(=O)[C@H](CC(C)C)NC(=O)[C@H](CCCNC(=N)N)NC(=O)[C@H](CCC(=O)O)NC(=O)[C@H](CCCNC(=N)N)NC(=O)[C@H](Cc1ccccc1)NC(=O)CNC(=O)[C@H](CS)NC(=O)[C@H](CCCNC(=N)N)NC(=O)[C@@H](NC(=O)[C@H](CCCNC(=N)N)NC(=O)[C@H](CCCNC(=N)N)NC(=O)[C@H](CS)NC(=O)[C@H](Cc1ccc(O)cc1)NC(=O)[C@H](CS)NC(=O)[C@@H](NC(=O)[C@@H](N)C(C)C)[C@@H](C)O)[C@@H](C)O)C(=O)N[C@H](C(=O)N[C@H](C(=O)N[C@@H](CS)C(=O)N[C@@H](Cc1ccc(O)cc1)C(=O)N[C@@H](CS)C(=O)N[C@@H](CCCNC(=N)N)C(=O)N[C@@H](CO)C(=O)N[C@H](C(=O)N[C@@H](CCCNC(=N)N)C(=O)N[C@@H](CS)C(=O)NCC(=O)N[C@@H](Cc1ccccc1)C(=O)O)[C@@H](C)O)[C@@H](C)O)C(C)C |
| Chemical_Modification | None |
| Cyclization_Method | None |
| Linear/Cyclic | Linear |
| N-terminal_Modification | Free |
| C-terminal_Modification | Free |
| Amino_Acid_Distribution | |
|
|
|
Peptide Physicochemical
| Molecular_Weight | 4418.17 |
|---|---|
| Aliphatic_Index | 38.42105 |
| Aromaticity | 0.13158 |
| Average_Rotatable_Bonds | 3.76316 |
| Charge_at_pH_7 | 7.56336 |
| Isoelectric_Point | 9.55153 |
|---|---|
| Hydrogen_Bond_Acceptors | 65 |
| Hydrogen_Bond_Donors | 83 |
| Topological_Polar_Surface_Area | 1916.49000 |
| X_logP_energy | -24.50207 |
Interaction Information
| Affinity | IC50=50 nM |
|---|---|
| Affinity_Assay | Enzyme Inhibition Kinetics |
| PDB_ID | None |
| Type | antagonist |
| Structure | |
Reference Information
| Document_Type | Research Articles |
|---|---|
| Title | Purification of cationic cystine-rich peptides from rat bone marrow. Primary structures and biological activity of the rat corticostatin family of peptides |
| Release_Year | 1992 |
| PMID | 1332140 |
| DOI | 10.1016/0167-0115(92)90086-a |