PPIRE03701
Target Protein Information
| Protein_Name | Lysosomal-associated transmembrane protein 4B |
|---|---|
| Protein_Sequence | MTSRTRVTWPSPPRPLPVPAAAAVAFGAKGTDPAEARSSRGIEEAGPRAHGRAGREPERRRSRQQRRGGLQARRSTLLKTCARARATAPGAMKMVAPWTRFYSNSCCLCCHVRTGTILLGVWYLIINAVVLLILLSALADPDQYNFSSSELGGDFEFMDDANMCIAIAISLLMILICAMATYGAYKQRAAWIIPFFCYQIFDFALNMLVAITVLIYPNSIQEYIRQLPPNFPYRDDVMSVNPTCLVLIILLFISIILTFKGYLISCVWNCYRYINGRNSSDVLVYVTSNDTTVLLPPYDDATVNGAAKEPPPPYVSA |
| Organism_Source | Homo sapiens |
| Functional_Classification | other |
| Cellular_Localization | Plasma membrane |
| Gene_Names | LAPTM4B |
| UniProt_ID | Q86VI4 |
| Protein-Protein Interaction Networks | |
Peptide Basic Information
| Peptide_Name | AP2H |
|---|---|
| Peptide_Sequence | IHGHHIISVG |
| Peptide_Length | 10 |
| Peptide_SMILES | CC[C@H](C)[C@H](N)C(=O)N[C@@H](Cc1c[nH]cn1)C(=O)NCC(=O)N[C@@H](Cc1c[nH]cn1)C(=O)N[C@@H](Cc1c[nH]cn1)C(=O)N[C@H](C(=O)N[C@H](C(=O)N[C@@H](CO)C(=O)N[C@H](C(=O)NCC(=O)O)C(C)C)[C@@H](C)CC)[C@@H](C)CC |
| Chemical_Modification | None |
| Cyclization_Method | None |
| Linear/Cyclic | Linear |
| N-terminal_Modification | Free |
| C-terminal_Modification | Free |
| Amino_Acid_Distribution | |
|
|
|
Peptide Physicochemical
| Molecular_Weight | 1069.23 |
|---|---|
| Aliphatic_Index | 146.00000 |
| Aromaticity | 0.00000 |
| Average_Rotatable_Bonds | 3.30000 |
| Charge_at_pH_7 | 0.27071 |
| Isoelectric_Point | 7.81100 |
|---|---|
| Hydrogen_Bond_Acceptors | 15 |
| Hydrogen_Bond_Donors | 15 |
| Topological_Polar_Surface_Area | 431.49000 |
| X_logP_energy | -3.29170 |
Interaction Information
| Affinity | KD=5.51 uM |
|---|---|
| Affinity_Assay | NMR chemical shift perturbation |
| PDB_ID | None |
| Type | Affinity ligand |
| Structure | |
Reference Information
| Document_Type | Research Articles |
|---|---|
| Title | Highly specific targeting and imaging of live cancer cells by using a peptide probe developed from rationally designed peptides. |
| Release_Year | 2011 |
| PMID | 21542089 |
| DOI | 10.1002/cbic.201100031 |