PPIRE04017
Target Protein Information
| Protein_Name | fMet-Leu-Phe receptor |
|---|---|
| Protein_Sequence | METNSSLPTNISGGTPAVSAGYLFLDIITYLVFAVTFVLGVLGNGLVIWVAGFRMTHTVTTISYLNLAVADFCFTSTLPFFMVRKAMGGHWPFGWFLCKFVFTIVDINLFGSVFLIALIALDRCVCVLHPVWTQNHRTVSLAKKVIIGPWVMALLLTLPVIIRVTTVPGKTGTVACTFNFSPWTNDPKERINVAVAMLTVRGIIRFIIGFSAPMSIVAVSYGLIATKIHKQGLIKSSRPLRVLSFVAAAFFLCWSPYQVVALIATVRIRELLQGMYKEIGIAVDVTSALAFFNSCLNPMLYVFMGQDFRERLIHALPASLERALTEDSTQTSDTATNSTLPSAEVELQAK |
| Organism_Source | Homo sapiens |
| Functional_Classification | G protein-coupled receptor |
| Cellular_Localization | Plasma membrane |
| Gene_Names | FPR1 |
| UniProt_ID | P21462 |
| Protein-Protein Interaction Networks | |
Peptide Basic Information
| Peptide_Name | 19a |
|---|---|
| Peptide_Sequence | WX |
| Peptide_Length | 2 |
| Peptide_SMILES | N[C@@H](Cc1c[nH]c2ccccc12)C(=O)NCC(=O)O |
| Chemical_Modification | X2=4-methylphenylalanine |
| Cyclization_Method | None |
| Linear/Cyclic | Linear |
| N-terminal_Modification | N-Benzoyl |
| C-terminal_Modification | methyl ester |
| Amino_Acid_Distribution | |
|
|
|
Peptide Physicochemical
| Molecular_Weight | 261.28 |
|---|---|
| Aliphatic_Index | 0.00000 |
| Aromaticity | 0.50000 |
| Average_Rotatable_Bonds | 2.50000 |
| Charge_at_pH_7 | -0.00202 |
| Isoelectric_Point | 6.10000 |
|---|---|
| Hydrogen_Bond_Acceptors | 3 |
| Hydrogen_Bond_Donors | 4 |
| Topological_Polar_Surface_Area | 108.21000 |
| X_logP_energy | 0.23850 |
Interaction Information
| Affinity | IC50=1.87 uM |
|---|---|
| Affinity_Assay | Enzyme Inhibition Kinetics |
| PDB_ID | None |
| Type | antagonist |
| Structure | |
Reference Information
| Document_Type | Research Articles |
|---|---|
| Title | Design and synthesis of tryptophan containing dipeptide derivatives as formyl peptide receptor 1 antagonist. |
| Release_Year | 2013 |
| PMID | 23629449 |
| DOI | 10.1039/c3ob40215k |