PPIRE04858
Target Protein Information
| Protein_Name | DNA repair protein RAD51 homolog 1 |
|---|---|
| Protein_Sequence | MAMQMQLEANADTSVEEESFGPQPISRLEQCGINANDVKKLEEAGFHTVEAVAYAPKKELINIKGISEAKADKILAEAAKLVPMGFTTATEFHQRRSEIIQITTGSKELDKLLQGGIETGSITEMFGEFRTGKTQICHTLAVTCQLPIDRGGGEGKAMYIDTEGTFRPERLLAVAERYGLSGSDVLDNVAYARAFNTDHQTQLLYQASAMMVESRYALLIVDSATALYRTDYSGRGELSARQMHLARFLRMLLRLADEFGVAVVITNQVVAQVDGAAMFAADPKKPIGGNIIAHASTTRLYLRKGRGETRICKIYDSPCLPEAEAMFAINADGVGDAKD |
| Organism_Source | Homo sapiens |
| Functional_Classification | recombinases |
| Cellular_Localization | Nucleus |
| Gene_Names | RAD51 |
| UniProt_ID | Q06609 |
| Protein-Protein Interaction Networks | |
Peptide Basic Information
| Peptide_Name | FHTG |
|---|---|
| Peptide_Sequence | FHTG |
| Peptide_Length | 4 |
| Peptide_SMILES | C[C@@H](O)[C@H](NC(=O)[C@H](Cc1c[nH]cn1)NC(=O)[C@@H](N)Cc1ccccc1)C(=O)NCC(=O)O |
| Chemical_Modification | None |
| Cyclization_Method | None |
| Linear/Cyclic | Linear |
| N-terminal_Modification | Acetyl |
| C-terminal_Modification | amide |
| Amino_Acid_Distribution | |
|
|
|
Peptide Physicochemical
| Molecular_Weight | 460.49 |
|---|---|
| Aliphatic_Index | 0.00000 |
| Aromaticity | 0.25000 |
| Average_Rotatable_Bonds | 3.00000 |
| Charge_at_pH_7 | 0.08889 |
| Isoelectric_Point | 7.55032 |
|---|---|
| Hydrogen_Bond_Acceptors | 7 |
| Hydrogen_Bond_Donors | 7 |
| Topological_Polar_Surface_Area | 199.53000 |
| X_logP_energy | -1.92660 |
Interaction Information
| Affinity | KD=2388 uM |
|---|---|
| Affinity_Assay | Isothermal titration calorimetry |
| PDB_ID | 5FOV |
| Type | Inhibitor |
| Structure | |
Reference Information
| Document_Type | Research Articles |
|---|---|
| Title | Structure-activity relationship of the peptide binding-motif mediating the BRCA2:RAD51 protein-protein interaction. |
| Release_Year | 2016 |
| PMID | 26992456 |
| DOI | 10.1002/1873-3468.12139 |