PPIRE06193
Target Protein Information
| Protein_Name | WD repeat-containing protein 5 |
|---|---|
| Protein_Sequence | MATEEKKPETEAARAQPTPSSSATQSKPTPVKPNYALKFTLAGHTKAVSSVKFSPNGEWLASSSADKLIKIWGAYDGKFEKTISGHKLGISDVAWSSDSNLLVSASDDKTLKIWDVSSGKCLKTLKGHSNYVFCCNFNPQSNLIVSGSFDESVRIWDVKTGKCLKTLPAHSDPVSAVHFNRDGSLIVSSSYDGLCRIWDTASGQCLKTLIDDDNPPVSFVKFSPNGKYILAATLDNTLKLWDYSKGKCLKTYTGHKNEKYCIFANFSVTGGKWIVSGSEDNLVYIWNLQTKEIVQKLQGHTDVVISTACHPTENIIASAALENDKTIKLWKSDC |
| Organism_Source | Homo sapiens |
| Functional_Classification | WD-40 repeat proteins |
| Cellular_Localization | Nucleus |
| Gene_Names | WDR5 |
| UniProt_ID | P61964 |
| Protein-Protein Interaction Networks | |
Peptide Basic Information
| Peptide_Name | Win6mer |
|---|---|
| Peptide_Sequence | ARTEVY |
| Peptide_Length | 6 |
| Peptide_SMILES | CC(C)[C@H](NC(=O)[C@H](CCC(=O)O)NC(=O)[C@@H](NC(=O)[C@H](CCCNC(=N)N)NC(=O)[C@H](C)N)[C@@H](C)O)C(=O)N[C@@H](Cc1ccc(O)cc1)C(=O)O |
| Chemical_Modification | None |
| Cyclization_Method | None |
| Linear/Cyclic | Linear |
| N-terminal_Modification | Acetyl |
| C-terminal_Modification | amide |
| Amino_Acid_Distribution | |
|
|
|
Peptide Physicochemical
| Molecular_Weight | 737.81 |
|---|---|
| Aliphatic_Index | 65.00000 |
| Aromaticity | 0.16667 |
| Average_Rotatable_Bonds | 3.66667 |
| Charge_at_pH_7 | -0.00109 |
| Isoelectric_Point | 6.40331 |
|---|---|
| Hydrogen_Bond_Acceptors | 11 |
| Hydrogen_Bond_Donors | 13 |
| Topological_Polar_Surface_Area | 348.48000 |
| X_logP_energy | -3.04463 |
Interaction Information
| Affinity | KD=2.9 nM |
|---|---|
| Affinity_Assay | Isothermal titration calorimetry |
| PDB_ID | 5SXM |
| Type | Inhibitor |
| Structure | |
Reference Information
| Document_Type | Research Articles |
|---|---|
| Title | Targeted Disruption of the Interaction between WD-40 Repeat Protein 5 (WDR5)and Mixed Lineage Leukemia (MLL)/SET1 Family Proteins Specifically Inhibits MLL1 and SETd1A Methyltransferase Complexes. |
| Release_Year | 2016 |
| PMID | 27563068 |
| DOI | 10.1074/jbc.M116.752626 |