PPIRE06630
Target Protein Information
| Protein_Name | Protein farnesyltransferase subunit beta |
|---|---|
| Protein_Sequence | MASSSSFTYYCPPSSSPVWSEPLYSLRPEHARERLQDDSVETVTSIEQAKVEEKIQEVFSSYKFNHLVPRLVLQREKHFHYLKRGLRQLTDAYECLDASRPWLCYWILHSLELLDEPIPQIVATDVCQFLELCQSPDGGFGGGPGQYPHLAPTYAAVNALCIIGTEEAYNVINREKLLQYLYSLKQPDGSFLMHVGGEVDVRSAYCAASVASLTNIITPDLFEGTAEWIARCQNWEGGIGGVPGMEAHGGYTFCGLAALVILKKERSLNLKSLLQWVTSRQMRFEGGFQGRCNKLVDGCYSFWQAGLLPLLHRALHAQGDPALSMSHWMFHQQALQEYILMCCQCPAGGLLDKPGKSRDFYHTCYCLSGLSIAQHFGSGAMLHDVVMGVPENVLQPTHPVYNIGPDKVIQATTHFLQKPVPGFEECEDAVTSDPATD |
| Organism_Source | Rattus norvegicus |
| Functional_Classification | prenyltransferases |
| Cellular_Localization | Cytoplasm |
| Gene_Names | Fntb |
| UniProt_ID | Q02293 |
| Protein-Protein Interaction Networks | |
Peptide Basic Information
| Peptide_Name | TKCVIM |
|---|---|
| Peptide_Sequence | TKCVIM |
| Peptide_Length | 6 |
| Peptide_SMILES | CC[C@H](C)[C@H](NC(=O)[C@@H](NC(=O)[C@H](CS)NC(=O)[C@H](CCCCN)NC(=O)[C@@H](N)[C@@H](C)O)C(C)C)C(=O)N[C@@H](CCSC)C(=O)O |
| Chemical_Modification | None |
| Cyclization_Method | None |
| Linear/Cyclic | Linear |
| N-terminal_Modification | Free |
| C-terminal_Modification | Free |
| Amino_Acid_Distribution | |
|
|
|
Peptide Physicochemical
| Molecular_Weight | 693.92 |
|---|---|
| Aliphatic_Index | 113.33333 |
| Aromaticity | 0.00000 |
| Average_Rotatable_Bonds | 3.83333 |
| Charge_at_pH_7 | 0.93571 |
| Isoelectric_Point | 8.54519 |
|---|---|
| Hydrogen_Bond_Acceptors | 11 |
| Hydrogen_Bond_Donors | 10 |
| Topological_Polar_Surface_Area | 255.07000 |
| X_logP_energy | -1.28290 |
Interaction Information
| Affinity | IC50=250 nM |
|---|---|
| Affinity_Assay | Enzyme Inhibition Kinetics |
| PDB_ID | None |
| Type | Inhibitor |
| Structure | |
Reference Information
| Document_Type | Research Articles |
|---|---|
| Title | The basis for K-Ras4B binding specificity to protein farnesyl-transferase revealed by 2 Angstrom resolution ternary complex structures |
| Release_Year | 2000 |
| PMID | 10673434 |
| DOI | 10.1016/S0969-2126(00)00096-4 |