PPIRE07509
Target Protein Information
| Protein_Name | Importin subunit alpha |
|---|---|
| Protein_Sequence | MDNGTDSSTSKFVPEYRRTNFKNKGRFSADELRRRRDTQQVELRKAKRDEALAKRRNFIPPTDGADSDEEDESSVSADQQFYSQLQQELPQMTQQLNSDDMQEQLSATVKFRQILSREHRPPIDVVIQAGVVPRLVEFMRENQPEMLQLEAAWALTNIASGTSAQTKVVVDADAVPLFIQLLYTGSVEVKEQAIWALGNVAGDSTDYRDYVLQCNAMEPILGLFNSNKPSLIRTATWTLSNLCRGKKPQPDWSVVSQALPTLAKLIYSMDTETLVDACWAISYLSDGPQEAIQAVIDVRIPKRLVELLSHESTLVQTPALRAVGNIVTGNDLQTQVVINAGVLPALRLLLSSPKENIKKEACWTISNITAGNTEQIQAVIDANLIPPLVKLLEVAEYKTKKEACWAISNASSGGLQRPDIIRYLVSQGCIKPLCDLLEIADNRIIEVTLDALENILKMGEADKEARGLNINENADFIEKAGGMEKIFNCQQNENDKIYEKAYKIIETYFGEEEDAVDETMAPQNAGNTFGFGSNVNQQFNFN |
| Organism_Source | Saccharomyces cerevisiae (strain ATCC 204508 / S288c) |
| Functional_Classification | nuclear transport receptors |
| Cellular_Localization | Nucleus |
| Gene_Names | SRP1 |
| UniProt_ID | Q02821 |
| Protein-Protein Interaction Networks | |
Peptide Basic Information
| Peptide_Name | SV40TAgNLS |
|---|---|
| Peptide_Sequence | PKKKRKV |
| Peptide_Length | 7 |
| Peptide_SMILES | CC(C)[C@H](NC(=O)[C@H](CCCCN)NC(=O)[C@H](CCCNC(=N)N)NC(=O)[C@H](CCCCN)NC(=O)[C@H](CCCCN)NC(=O)[C@H](CCCCN)NC(=O)[C@@H]1CCCN1)C(=O)O |
| Chemical_Modification | None |
| Cyclization_Method | None |
| Linear/Cyclic | Linear |
| N-terminal_Modification | Free |
| C-terminal_Modification | Free |
| Amino_Acid_Distribution | |
|
|
|
Peptide Physicochemical
| Molecular_Weight | 883.15 |
|---|---|
| Aliphatic_Index | 41.42857 |
| Aromaticity | 0.00000 |
| Average_Rotatable_Bonds | 4.85714 |
| Charge_at_pH_7 | 4.99680 |
| Isoelectric_Point | 11.99738 |
|---|---|
| Hydrogen_Bond_Acceptors | 13 |
| Hydrogen_Bond_Donors | 15 |
| Topological_Polar_Surface_Area | 389.91000 |
| X_logP_energy | -2.83293 |
Interaction Information
| Affinity | KD=11 nM |
|---|---|
| Affinity_Assay | microtiter plate binding assay |
| PDB_ID | None |
| Type | Affinity ligand |
| Structure | |
Reference Information
| Document_Type | Research Articles |
|---|---|
| Title | Crystal structure of rice importin-Alpha and structural basis of its interaction with plant-specific nuclear localization signals. |
| Release_Year | 2012 |
| PMID | 23250448 |
| DOI | 10.1105/tpc.112.104422 |