PPIRE07512
Target Protein Information
| Protein_Name | Importin subunit alpha-1 |
|---|---|
| Protein_Sequence | MSTNENANLPAARLNRFKNKGKDSTEMRRRRIEVNVELRKAKKDEQMLKRRNVSSFPDDATSPLQENRNNQGTVNWSVEDIVKGINSNNLESQLQATQAARKLLSREKQPPIDNIIRAGLIPKFVSFLGKTDCSPIQFESAWALTNIASGTSEQTKAVVDGGAIPAFISLLASPHAHISEQAVWALGNIAGDGSAFRDLVIKHGAIDPLLALLAVPDLSTLACGYLRNLTWTLSNLCRNKNPAPPLDAVEQILPTLVRLLHHNDPEVLADSCWAISYLTDGPNERIEMVVKKGVVPQLVKLLGATELPIVTPALRAIGNIVTGTDEQTQKVIDAGALAVFPSLLTNPKTNIQKEATWTMSNITAGRQDQIQQVVNHGLVPFLVGVLSKADFKTQKEAAWAITNYTSGGTVEQIVYLVHCGIIEPLMNLLSAKDTKIIQVILDAISNIFQAAEKLGETEKLSIMIEECGGLDKIEALQRHENESVYKASLNLIEKYFSVEEEEDQNVVPETTSEGFAFQVQDGAPGTFNF |
| Organism_Source | Mus musculus |
| Functional_Classification | nuclear transport receptors |
| Cellular_Localization | Nucleus |
| Gene_Names | Kpna2 |
| UniProt_ID | P52293 |
| Protein-Protein Interaction Networks | |
Peptide Basic Information
| Peptide_Name | B54NLS |
|---|---|
| Peptide_Sequence | LGKRKRF |
| Peptide_Length | 7 |
| Peptide_SMILES | CC(C)C[C@H](N)C(=O)NCC(=O)N[C@@H](CCCCN)C(=O)N[C@@H](CCCNC(=N)N)C(=O)N[C@@H](CCCCN)C(=O)N[C@@H](CCCNC(=N)N)C(=O)N[C@@H](Cc1ccccc1)C(=O)O |
| Chemical_Modification | None |
| Cyclization_Method | None |
| Linear/Cyclic | Linear |
| N-terminal_Modification | Free |
| C-terminal_Modification | Free |
| Amino_Acid_Distribution | |
|
|
|
Peptide Physicochemical
| Molecular_Weight | 904.13 |
|---|---|
| Aliphatic_Index | 55.71429 |
| Aromaticity | 0.14286 |
| Average_Rotatable_Bonds | 4.71429 |
| Charge_at_pH_7 | 3.99739 |
| Isoelectric_Point | 12.53175 |
|---|---|
| Hydrogen_Bond_Acceptors | 12 |
| Hydrogen_Bond_Donors | 16 |
| Topological_Polar_Surface_Area | 413.76000 |
| X_logP_energy | -2.98816 |
Interaction Information
| Affinity | KD=140 nM |
|---|---|
| Affinity_Assay | microtiter plate binding assay |
| PDB_ID | None |
| Type | Affinity ligand |
| Structure | |
Reference Information
| Document_Type | Research Articles |
|---|---|
| Title | Crystal structure of rice importin-Alpha and structural basis of its interaction with plant-specific nuclear localization signals. |
| Release_Year | 2012 |
| PMID | 23250448 |
| DOI | 10.1105/tpc.112.104422 |