PPIRE07522
Target Protein Information
| Protein_Name | None |
|---|---|
| Protein_Sequence | LRDVEEDVKGKLDEWLNALVHLDKQQVERIYEELQGEMKHVLDFEIINYYKLLYTRYLIMKRDFPALEEELDKLKKVYKKYSPFQKLLYMYSRGLLCCLQYRWKDGLDYLLKTEVMAKEQGYHETGLYYNIALAYTHLDIHHLAIHFVNMALEGFRSEYKFRNIINCQILIAVSYTEKGQYEEALKMYESILREATSFADKDVLLAITLSNMGSIYYKKGKYQQAKKYYLDSLQLQKQIDLNYLDTIYEMALVCIKLEELDEARALIDKGIDAAKQEERFNAKLYLLLMLRYKYFEEAKDYKLFLENEAIPLYKSAGNKIELKKVYVELAEHFSNLSRFEESNRYYRLVIDLMNDNKEE |
| Organism_Source | Bacillus thuringiensis subsp. israelensis |
| Functional_Classification | RNPP family |
| Cellular_Localization | Cytoplasm |
| Gene_Names | nprR |
| UniProt_ID | G5DDY0 |
| Protein-Protein Interaction Networks | |
Peptide Basic Information
| Peptide_Name | NprX7 |
|---|---|
| Peptide_Sequence | SKPDIVG |
| Peptide_Length | 7 |
| Peptide_SMILES | CC[C@H](C)[C@H](NC(=O)[C@H](CC(=O)O)NC(=O)[C@@H]1CCCN1C(=O)[C@H](CCCCN)NC(=O)[C@@H](N)CO)C(=O)N[C@H](C(=O)NCC(=O)O)C(C)C |
| Chemical_Modification | None |
| Cyclization_Method | None |
| Linear/Cyclic | Linear |
| N-terminal_Modification | Free |
| C-terminal_Modification | Free |
| Amino_Acid_Distribution | |
|
|
|
Peptide Physicochemical
| Molecular_Weight | 714.82 |
|---|---|
| Aliphatic_Index | 97.14286 |
| Aromaticity | 0.00000 |
| Average_Rotatable_Bonds | 3.14286 |
| Charge_at_pH_7 | -0.00186 |
| Isoelectric_Point | 6.33737 |
|---|---|
| Hydrogen_Bond_Acceptors | 11 |
| Hydrogen_Bond_Donors | 10 |
| Topological_Polar_Surface_Area | 312.68000 |
| X_logP_energy | -3.25720 |
Interaction Information
| Affinity | KD=0.1 mM |
|---|---|
| Affinity_Assay | Isothermal titration calorimetry |
| PDB_ID | None |
| Type | Agonist |
| Structure | |
Reference Information
| Document_Type | Research Articles |
|---|---|
| Title | Peptide-binding dependent conformational changes regulate the transcriptional activity of the quorum-sensor NprR. |
| Release_Year | 2013 |
| PMID | 23793817 |
| DOI | 10.1093/nar/gkt546 |