PPIRE07575
Target Protein Information
| Protein_Name | Retinal rod rhodopsin-sensitive cGMP 3',5'-cyclic phosphodiesterase subunit delta |
|---|---|
| Protein_Sequence | MSAKDERAREILRGFKLNWMNLRDAETGKILWQGTEDLSVPGVEHEARVPKKILKCKAVSRELNFSSTEQMEKFRLEQKVYFKGQCLEEWFFEFGFVIPNSTNTWQSLIEAAPESQMMPASVLTGNVIIETKFFDDDLLVSTSRVRLFYV |
| Organism_Source | Homo sapiens |
| Functional_Classification | prenyl-binding proteins |
| Cellular_Localization | Cytoplasm |
| Gene_Names | PDE6D |
| UniProt_ID | O43924 |
| Protein-Protein Interaction Networks | |
Peptide Basic Information
| Peptide_Name | Gerger-PDE6a -peptide |
|---|---|
| Peptide_Sequence | DDKKSKTX |
| Peptide_Length | 8 |
| Peptide_SMILES | C[C@@H](O)[C@H](NC(=O)[C@H](CCCCN)NC(=O)[C@H](CO)NC(=O)[C@H](CCCCN)NC(=O)[C@H](CCCCN)NC(=O)[C@H](CC(=O)O)NC(=O)[C@@H](N)CC(=O)O)C(=O)NCC(=O)O |
| Chemical_Modification | X8=geranylgeranylation |
| Cyclization_Method | None |
| Linear/Cyclic | Linear |
| N-terminal_Modification | Free |
| C-terminal_Modification | methyl esterification |
| Amino_Acid_Distribution | |
|
|
|
Peptide Physicochemical
| Molecular_Weight | 877.95 |
|---|---|
| Aliphatic_Index | 0.00000 |
| Aromaticity | 0.00000 |
| Average_Rotatable_Bonds | 4.12500 |
| Charge_at_pH_7 | 0.99799 |
| Isoelectric_Point | 9.44154 |
|---|---|
| Hydrogen_Bond_Acceptors | 16 |
| Hydrogen_Bond_Donors | 16 |
| Topological_Polar_Surface_Area | 460.14000 |
| X_logP_energy | -6.86720 |
Interaction Information
| Affinity | KD=2.3 nM |
|---|---|
| Affinity_Assay | Fluorescence Polarization |
| PDB_ID | 5E8F |
| Type | Inhibitor |
| Structure | |
Reference Information
| Document_Type | Research Articles |
|---|---|
| Title | The N- and C-terminal ends of RPGR can bind to PDE6Delte. |
| Release_Year | 2015 |
| PMID | 26553937 |
| DOI | 10.15252/embr.201541404 |