PPIRE07923
Target Protein Information
| Protein_Name | Cysteine proteinase B |
|---|---|
| Protein_Sequence | MATSRAALCAVAVVCVVLAAACAPARAIHVGTPAAALFEEFKRTYGRAYETLAEEQQRLANFERNLELMREHQARNPHAQFGITKFFDLSEAEFAARYLNGAAYFAAAKRHAAQHYRKARADLSAVPDAVDWREKGAVTPVKDQGACGSCWAFSAVGNIEGQWYLAGHELVSLSEQQLVSCDDMNDGCDGGLMLQAFDWLLQNTNGHLHTEDSYPYVSGNGYVPECSNSSELVVGAQIDGHVLIGSSEKAMAAWLAKNGPIAIALDASSFMSYKSGVLTACIGKQLNHGVLLVGYDMTGEVPYWVIKNSWGGDWGEQGYVRVVMGVNACLLSEYPVSAHVRESAAPGTSTSSETPAPRPVMVEQVICFDKNCTQGCRKTLIKANECHKNGGGGASMIKCSPQKVTMCTYSNEFCVGGGLCFETPDGKCAPYFLGSIMNTCHYT |
| Organism_Source | Leishmania mexicana |
| Functional_Classification | cysteine proteinases |
| Cellular_Localization | Lysosome |
| Gene_Names | LMCPB |
| UniProt_ID | P36400 |
| Protein-Protein Interaction Networks | |
Peptide Basic Information
| Peptide_Name | Peptide V |
|---|---|
| Peptide_Sequence | YRFFRNRF |
| Peptide_Length | 8 |
| Peptide_SMILES | N=C(N)NCCC[C@H](NC(=O)[C@H](CC(N)=O)NC(=O)[C@H](CCCNC(=N)N)NC(=O)[C@H](Cc1ccccc1)NC(=O)[C@H](Cc1ccccc1)NC(=O)[C@H](CCCNC(=N)N)NC(=O)[C@@H](N)Cc1ccc(O)cc1)C(=O)N[C@@H](Cc1ccccc1)C(=O)O |
| Chemical_Modification | None |
| Cyclization_Method | None |
| Linear/Cyclic | Linear |
| N-terminal_Modification | Abz |
| C-terminal_Modification | Q-EDDnp |
| Amino_Acid_Distribution | |
|
|
|
Peptide Physicochemical
| Molecular_Weight | 1205.39 |
|---|---|
| Aliphatic_Index | 0.00000 |
| Aromaticity | 0.50000 |
| Average_Rotatable_Bonds | 4.62500 |
| Charge_at_pH_7 | 2.99712 |
| Isoelectric_Point | 12.20421 |
|---|---|
| Hydrogen_Bond_Acceptors | 14 |
| Hydrogen_Bond_Donors | 20 |
| Topological_Polar_Surface_Area | 516.04000 |
| X_logP_energy | -2.86649 |
Interaction Information
| Affinity | Ki=39 nM |
|---|---|
| Affinity_Assay | Enzyme Inhibition Kinetics |
| PDB_ID | None |
| Type | Inhibitor |
| Structure | |
Reference Information
| Document_Type | Research Articles |
|---|---|
| Title | Identification of peptides inhibitory to recombinant cysteine proteinase, CPB, of Leishmania mexicana. |
| Release_Year | 2001 |
| PMID | 11356516 |
| DOI | 10.1016/S0166-6851(01)00239-0 |