PPIRE08044
Target Protein Information
| Protein_Name | E3 ubiquitin-protein ligase XIAP |
|---|---|
| Protein_Sequence | MTFNSFEGSKTCVPADINKEEEFVEEFNRLKTFANFPSGSPVSASTLARAGFLYTGEGDTVRCFSCHAAVDRWQYGDSAVGRHRKVSPNCRFINGFYLENSATQSTNSGIQNGQYKVENYLGSRDHFALDRPSETHADYLLRTGQVVDISDTIYPRNPAMYSEEARLKSFQNWPDYAHLTPRELASAGLYYTGIGDQVQCFCCGGKLKNWEPCDRAWSEHRRHFPNCFFVLGRNLNIRSESDAVSSDRNFPNSTNLPRNPSMADYEARIFTFGTWIYSVNKEQLARAGFYALGEGDKVKCFHCGGGLTDWKPSEDPWEQHAKWYPGCKYLLEQKGQEYINNIHLTHSLEECLVRTTEKTPSLTRRIDDTIFQNPMVQEAIRMGFSFKDIKKIMEEKIQISGSNYKSLEVLVADLVNAQKDSMQDESSQTSLQKEISTEEQLRRLQEEKLCKICMDRNIAIVFVPCGHLVTCKQCAEAVDKCPMCYTVITFKQKIFMS |
| Organism_Source | Homo sapiens |
| Functional_Classification | inhibitor of apoptosis proteins |
| Cellular_Localization | Cytoplasm |
| Gene_Names | XIAP |
| UniProt_ID | P98170 |
| Protein-Protein Interaction Networks | |
Peptide Basic Information
| Peptide_Name | 3F probe |
|---|---|
| Peptide_Sequence | XRPFAQKX |
| Peptide_Length | 8 |
| Peptide_SMILES | C[C@H](NC(=O)[C@H](Cc1ccccc1)NC(=O)[C@@H]1CCCN1C(=O)[C@H](CCCNC(=N)N)NC(=O)CN)C(=O)N[C@@H](CCC(N)=O)C(=O)N[C@@H](CCCCN)C(=O)NCC(=O)O |
| Chemical_Modification | X1=LL-2-aminobutyric acid; X8=5-carboxyfluorescein |
| Cyclization_Method | None |
| Linear/Cyclic | Linear |
| N-terminal_Modification | Free |
| C-terminal_Modification | amide |
| Amino_Acid_Distribution | |
|
|
|
Peptide Physicochemical
| Molecular_Weight | 859.98 |
|---|---|
| Aliphatic_Index | 12.50000 |
| Aromaticity | 0.12500 |
| Average_Rotatable_Bonds | 3.37500 |
| Charge_at_pH_7 | 1.99769 |
| Isoelectric_Point | 11.65178 |
|---|---|
| Hydrogen_Bond_Acceptors | 12 |
| Hydrogen_Bond_Donors | 13 |
| Topological_Polar_Surface_Area | 389.24000 |
| X_logP_energy | -4.51873 |
Interaction Information
| Affinity | KD=77.6 nM |
|---|---|
| Affinity_Assay | Fluorescence Polarization |
| PDB_ID | None |
| Type | Affinity ligand |
| Structure | |
Reference Information
| Document_Type | Research Articles |
|---|---|
| Title | Development and optimization of a binding assay for the XIAP BIR3 domain using fluorescence polarization. |
| Release_Year | 2004 |
| PMID | 15325294 |
| DOI | 10.1016/j.ab.2004.05.055 |