PPIRE08158
Target Protein Information
| Protein_Name | C-X-C chemokine receptor type 4 |
|---|---|
| Protein_Sequence | MEGISIYTSDNYTEEMGSGDYDSMKEPCFREENANFNKIFLPTIYSIIFLTGIVGNGLVILVMGYQKKLRSMTDKYRLHLSVADLLFVITLPFWAVDAVANWYFGNFLCKAVHVIYTVNLYSSVLILAFISLDRYLAIVHATNSQRPRKLLAEKVVYVGVWIPALLLTIPDFIFANVSEADDRYICDRFYPNDLWVVVFQFQHIMVGLILPGIVILSCYCIIISKLSHSKGHQKRKALKTTVILILAFFACWLPYYIGISIDSFILLEIIKQGCEFENTVHKWISITEALAFFHCCLNPILYAFLGAKFKTSAQHALTSVSRGSSLKILSKGKRGGHSSVSTESESSSFHSS |
| Organism_Source | Homo sapiens |
| Functional_Classification | G protein-coupled receptor |
| Cellular_Localization | Plasma membrane |
| Gene_Names | CXCR4 |
| UniProt_ID | P61073 |
| Protein-Protein Interaction Networks | |
Peptide Basic Information
| Peptide_Name | LY2510924 |
|---|---|
| Peptide_Sequence | FYXrXGeX |
| Peptide_Length | 8 |
| Peptide_SMILES | N=C(N)NCCC[C@H](NC(=O)CNC(=O)[C@H](Cc1ccc(O)cc1)NC(=O)[C@@H](N)Cc1ccccc1)C(=O)NCC(=O)NCC(=O)N[C@@H](CCC(=O)O)C(=O)NCC(=O)O |
| Chemical_Modification | X3=N6-isopropyllysine; X5=2-naphthylalanine; X8=N6-isopropyllysine |
| Cyclization_Method | Main chain-side chain cyclization; E7<->F1; amide bond |
| Linear/Cyclic | Cyclic |
| N-terminal_Modification | None |
| C-terminal_Modification | amide |
| Amino_Acid_Distribution | |
|
|
|
Peptide Physicochemical
| Molecular_Weight | 841.88 |
|---|---|
| Aliphatic_Index | 0.00000 |
| Aromaticity | 0.25000 |
| Average_Rotatable_Bonds | 3.25000 |
| Charge_at_pH_7 | -0.00109 |
| Isoelectric_Point | 6.40331 |
|---|---|
| Hydrogen_Bond_Acceptors | 12 |
| Hydrogen_Bond_Donors | 14 |
| Topological_Polar_Surface_Area | 386.45000 |
| X_logP_energy | -4.36343 |
Interaction Information
| Affinity | IC50=0.0797 nM |
|---|---|
| Affinity_Assay | radioligand binding assay |
| PDB_ID | None |
| Type | antagonist |
| Structure | |
Reference Information
| Document_Type | Research Articles |
|---|---|
| Title | Identification of LY2510924, a novel cyclic peptide CXCR4 antagonist that exhibits antitumor activities in solid tumor and breast cancer metastatic models. |
| Release_Year | 2014 |
| PMID | 25504752 |
| DOI | 10.1158/1535-7163.MCT-14-0850 |