PPIRE08183
Target Protein Information
| Protein_Name | Tumor susceptibility gene 101 protein |
|---|---|
| Protein_Sequence | MAVSESQLKKMVSKYKYRDLTVRETVNVITLYKDLKPVLDSYVFNDGSSRELMNLTGTIPVPYRGNTYNIPICLWLLDTYPYNPPICFVKPTSSMTIKTGKHVDANGKIYLPYLHEWKHPQSDLLGLIQVMIVVFGDEPPVFSRPISASYPPYQATGPPNTSYMPGMPGGISPYPSGYPPNPSGYPGCPYPPGGPYPATTSSQYPSQPPVTTVGPSRDGTISEDTIRASLISAVSDKLRWRMKEEMDRAQAELNALKRTEEDLKKGHQKLEEMVTRLDQEVAEVDKNIELLKKKDEELSSALEKMENQSENNDIDEVIIPTAPLYKQILNLYAEENAIEDTIFYLGEALRRGVIDLDVFLKHVRLLSRKQFQLRALMQKARKTAGLSDLY |
| Organism_Source | Homo sapiens |
| Functional_Classification | ubiquitin-binding proteins |
| Cellular_Localization | Cytoplasm |
| Gene_Names | TSG101 |
| UniProt_ID | Q99816 |
| Protein-Protein Interaction Networks | |
Peptide Basic Information
| Peptide_Name | A4 |
|---|---|
| Peptide_Sequence | SGWAYWNV |
| Peptide_Length | 8 |
| Peptide_SMILES | CC(C)[C@H](NC(=O)[C@H](CC(N)=O)NC(=O)[C@H](Cc1c[nH]c2ccccc12)NC(=O)[C@H](Cc1ccc(O)cc1)NC(=O)[C@H](C)NC(=O)[C@H](Cc1c[nH]c2ccccc12)NC(=O)CNC(=O)[C@@H](N)CO)C(=O)O |
| Chemical_Modification | None |
| Cyclization_Method | Main chain-main chain cyclization; S1<->V8; amide bond |
| Linear/Cyclic | Cyclic |
| N-terminal_Modification | None |
| C-terminal_Modification | None |
| Amino_Acid_Distribution | |
|
|
|
Peptide Physicochemical
| Molecular_Weight | 982.06 |
|---|---|
| Aliphatic_Index | 48.75000 |
| Aromaticity | 0.37500 |
| Average_Rotatable_Bonds | 3.12500 |
| Charge_at_pH_7 | -0.00287 |
| Isoelectric_Point | 6.09320 |
|---|---|
| Hydrogen_Bond_Acceptors | 12 |
| Hydrogen_Bond_Donors | 14 |
| Topological_Polar_Surface_Area | 382.15000 |
| X_logP_energy | -1.63680 |
Interaction Information
| Affinity | IC50=79.3 uM |
|---|---|
| Affinity_Assay | ELISA |
| PDB_ID | None |
| Type | Inhibitor |
| Structure | |
Reference Information
| Document_Type | Research Articles |
|---|---|
| Title | Development of a Cyclic Peptide Inhibitor of the p6/UEV Protein-Protein Interaction. |
| Release_Year | 2019 |
| PMID | 31411851 |
| DOI | 10.1021/acschembio.9b00627 |