PPIRE08222
Target Protein Information
| Protein_Name | Type-2 angiotensin II receptor |
|---|---|
| Protein_Sequence | MKGNSTLATTSKNITSGLHFGLVNISGNNESTLNCSQKPSDKHLDAIPILYYIIFVIGFLVNIVVVTLFCCQKGPKKVSSIYIFNLAVADLLLLATLPLWATYYSYRYDWLFGPVMCKVFGSFLTLNMFASIFFITCMSVDRYQSVIYPFLSQRRNPWQASYIVPLVWCMACLSSLPTFYFRDVRTIEYLGVNACIMAFPPEKYAQWSAGIALMKNILGFIIPLIFIATCYFGIRKHLLKTNSYGKNRITRDQVLKMAAAVVLAFIICWLPFHVLTFLDALAWMGVINSCEVIAVIDLALPFAILLGFTNSCVNPFLYCFVGNRFQQKLRSVFRVPITWLQGKRESMSCRKSSSLREMETFVS |
| Organism_Source | Homo sapiens |
| Functional_Classification | G protein-coupled receptor |
| Cellular_Localization | Plasma membrane |
| Gene_Names | AGTR2 |
| UniProt_ID | P50052 |
| Protein-Protein Interaction Networks | |
Peptide Basic Information
| Peptide_Name | s-AngII |
|---|---|
| Peptide_Sequence | XRVYIHPI |
| Peptide_Length | 8 |
| Peptide_SMILES | CC[C@H](C)[C@H](NC(=O)[C@@H]1CCCN1C(=O)[C@H](Cc1c[nH]cn1)NC(=O)[C@@H](NC(=O)[C@H](Cc1ccc(O)cc1)NC(=O)[C@@H](NC(=O)[C@H](CCCNC(=N)N)NC(=O)CN)C(C)C)[C@@H](C)CC)C(=O)O |
| Chemical_Modification | X1=Sar |
| Cyclization_Method | None |
| Linear/Cyclic | Linear |
| N-terminal_Modification | Free |
| C-terminal_Modification | Free |
| Amino_Acid_Distribution | |
|
|
|
Peptide Physicochemical
| Molecular_Weight | 954.14 |
|---|---|
| Aliphatic_Index | 133.75000 |
| Aromaticity | 0.12500 |
| Average_Rotatable_Bonds | 3.37500 |
| Charge_at_pH_7 | 1.08804 |
| Isoelectric_Point | 9.35118 |
|---|---|
| Hydrogen_Bond_Acceptors | 12 |
| Hydrogen_Bond_Donors | 13 |
| Topological_Polar_Surface_Area | 369.04000 |
| X_logP_energy | -1.14493 |
Interaction Information
| Affinity | KD=1.46 nM |
|---|---|
| Affinity_Assay | radioligand-binding assay |
| PDB_ID | 5XLI |
| Type | Agonist |
| Structure | |
Reference Information
| Document_Type | Research Articles |
|---|---|
| Title | Crystal structure of the human angiotensin II type 2 receptor bound to an angiotensin II analog. |
| Release_Year | 2018 |
| PMID | 29967536 |
| DOI | 10.1038/s41594-018-0079-8 |