PPIRE08392
Target Protein Information
| Protein_Name | Peroxisomal membrane protein PEX14 |
|---|---|
| Protein_Sequence | MASSEQAEQPSQPSSTPGSENVLPREPLIATAVKFLQNSRVRQSPLATRRAFLKKKGLTDEEIDMAFQQSGTAADEPSSLGPATQVVPVQPPHLISQPYSPAGSRWRDYGALAIIMAGIAFGFHQLYKKYLLPLILGGREDRKQLERMEAGLSELSGSVAQTVTQLQTTLASVQELLIQQQQKIQELAHELAAAKATTSTNWILESQNINELKSEINSLKGLLLNRRQFPPSPSAPKIPSWQIPVKSPSPSSPAAVNHHSSSDISPVSNESTSSSPGKEGHSPEGSTVTYHLLGPQEEGEGVVDVKGQVRMEVQGEEEKREDKEDEEDEEDDDVSHVDEEDCLGVQREDRRGGDGQINEQVEKLRRPEGASNESERD |
| Organism_Source | Homo sapiens |
| Functional_Classification | peroxisomal import receptor |
| Cellular_Localization | Cytoplasm |
| Gene_Names | PEX14 |
| UniProt_ID | O75381 |
| Protein-Protein Interaction Networks | |
Peptide Basic Information
| Peptide_Name | Pex5(116-124) |
|---|---|
| Peptide_Sequence | ENWAQEFLA |
| Peptide_Length | 9 |
| Peptide_SMILES | CC(C)C[C@H](NC(=O)[C@H](Cc1ccccc1)NC(=O)[C@H](CCC(=O)O)NC(=O)[C@H](CCC(N)=O)NC(=O)[C@H](C)NC(=O)[C@H](Cc1c[nH]c2ccccc12)NC(=O)[C@H](CC(N)=O)NC(=O)[C@@H](N)CCC(=O)O)C(=O)N[C@@H](C)C(=O)O |
| Chemical_Modification | None |
| Cyclization_Method | None |
| Linear/Cyclic | Linear |
| N-terminal_Modification | Free |
| C-terminal_Modification | Free |
| Amino_Acid_Distribution | |
|
|
|
Peptide Physicochemical
| Molecular_Weight | 1107.19 |
|---|---|
| Aliphatic_Index | 65.55556 |
| Aromaticity | 0.22222 |
| Average_Rotatable_Bonds | 3.77778 |
| Charge_at_pH_7 | -1.99847 |
| Isoelectric_Point | 3.61369 |
|---|---|
| Hydrogen_Bond_Acceptors | 14 |
| Hydrogen_Bond_Donors | 15 |
| Topological_Polar_Surface_Area | 472.69000 |
| X_logP_energy | -2.80020 |
Interaction Information
| Affinity | KD=0.47 mM |
|---|---|
| Affinity_Assay | Isothermal titration calorimetry |
| PDB_ID | 2W84 |
| Type | Affinity ligand |
| Structure | |
Reference Information
| Document_Type | Research Articles |
|---|---|
| Title | Structural basis for competitive interactions of Pex14 with the import receptors Pex5 and Pex19. |
| Release_Year | 2009 |
| PMID | 19197237 |
| DOI | 10.1038/emboj.2009.7 |