PPIRE08623
Target Protein Information
| Protein_Name | Tumor susceptibility gene 101 protein |
|---|---|
| Protein_Sequence | MAVSESQLKKMVSKYKYRDLTVRETVNVITLYKDLKPVLDSYVFNDGSSRELMNLTGTIPVPYRGNTYNIPICLWLLDTYPYNPPICFVKPTSSMTIKTGKHVDANGKIYLPYLHEWKHPQSDLLGLIQVMIVVFGDEPPVFSRPISASYPPYQATGPPNTSYMPGMPGGISPYPSGYPPNPSGYPGCPYPPGGPYPATTSSQYPSQPPVTTVGPSRDGTISEDTIRASLISAVSDKLRWRMKEEMDRAQAELNALKRTEEDLKKGHQKLEEMVTRLDQEVAEVDKNIELLKKKDEELSSALEKMENQSENNDIDEVIIPTAPLYKQILNLYAEENAIEDTIFYLGEALRRGVIDLDVFLKHVRLLSRKQFQLRALMQKARKTAGLSDLY |
| Organism_Source | Homo sapiens |
| Functional_Classification | endosomal sorting proteins |
| Cellular_Localization | Cytoplasm |
| Gene_Names | TSG101 |
| UniProt_ID | Q99816 |
| Protein-Protein Interaction Networks | |
Peptide Basic Information
| Peptide_Name | peptide2 |
|---|---|
| Peptide_Sequence | PEXTAPPEE |
| Peptide_Length | 9 |
| Peptide_SMILES | C[C@H](NC(=O)[C@@H](NC(=O)CNC(=O)[C@H](CCC(=O)O)NC(=O)[C@@H]1CCCN1)[C@@H](C)O)C(=O)N1CCC[C@H]1C(=O)N1CCC[C@H]1C(=O)N[C@@H](CCC(=O)O)C(=O)N[C@@H](CCC(=O)O)C(=O)O |
| Chemical_Modification | X3=3,4-dimethoxybenzyl oxime |
| Cyclization_Method | None |
| Linear/Cyclic | Linear |
| N-terminal_Modification | Free |
| C-terminal_Modification | Free |
| Amino_Acid_Distribution | |
|
|
|
Peptide Physicochemical
| Molecular_Weight | 925.95 |
|---|---|
| Aliphatic_Index | 11.11111 |
| Aromaticity | 0.00000 |
| Average_Rotatable_Bonds | 2.77778 |
| Charge_at_pH_7 | -2.99669 |
| Isoelectric_Point | 3.47280 |
|---|---|
| Hydrogen_Bond_Acceptors | 14 |
| Hydrogen_Bond_Donors | 12 |
| Topological_Polar_Surface_Area | 396.68000 |
| X_logP_energy | -4.65970 |
Interaction Information
| Affinity | KD=72 uM |
|---|---|
| Affinity_Assay | Surface plasmon resonance |
| PDB_ID | 3P9H |
| Type | antagonist |
| Structure | |
Reference Information
| Document_Type | Research Articles |
|---|---|
| Title | Elucidation of New Binding Interactions with the Tumor Susceptibility Gene 101 (Tsg101)Protein Using Modified HIV-1 Gag-p6 Derived Peptide Ligands. |
| Release_Year | 2011 |
| PMID | 21643473 |
| DOI | 10.1021/ml1002579 |