PPIRE08657
Target Protein Information
| Protein_Name | Aprataxin and PNK-like factor |
|---|---|
| Protein_Sequence | MSGGFELQPRDGGPRVALAPGETVIGRGPLLGITDKRVSRRHAILEVAGGQLRIKPIHTNPCFYQSSEKSQLLPLKPNLWCYLNPGDSFSLLVDKYIFRILSIPSEVEMQCTLRNSQVLDEDNILNETPKSPVINLPHETTGASQLEGSTEIAKTQMTPTNSVSFLGENRDCNKQQPILAERKRILPTWMLAEHLSDQNLSVPAISGGNVIQGSGKEEICKDKSQLNTTQQGRRQLISSGSSENTSAEQDTGEECKNTDQEESTISSKEMPQSFSAITLSNTEMNNIKTNAQRNKLPIEELGKVSKHKIATKRTPHKEDEAMSCSENCSSAQGDSLQDESQGSHSESSSNPSNPETLHAKATDSVLQGSEGNKVKRTSCMYGANCYRKNPVHFQHFSHPGDSDYGGVQIVGQDETDDRPECPYGPSCYRKNPQHKIEYRHNTLPVRNVLDEDNDNVGQPNEYDLNDSFLDDEEEDYEPTDEDSDWEPGKEDEEKEDVEELLKEAKRFMKRK |
| Organism_Source | Homo sapiens |
| Functional_Classification | forkhead-associated domains |
| Cellular_Localization | Nucleus |
| Gene_Names | APLF |
| UniProt_ID | Q8IW19 |
| Protein-Protein Interaction Networks | |
Peptide Basic Information
| Peptide_Name | XRCC1pSpT-9 |
|---|---|
| Peptide_Sequence | PYAGXXDEN |
| Peptide_Length | 9 |
| Peptide_SMILES | C[C@H](NC(=O)[C@H](Cc1ccc(O)cc1)NC(=O)[C@@H]1CCCN1)C(=O)NCC(=O)NCC(=O)NCC(=O)N[C@@H](CC(=O)O)C(=O)N[C@@H](CCC(=O)O)C(=O)N[C@@H](CC(N)=O)C(=O)O |
| Chemical_Modification | X5=phosphoserine; X6=phosphothreonine |
| Cyclization_Method | None |
| Linear/Cyclic | Linear |
| N-terminal_Modification | Free |
| C-terminal_Modification | Free |
| Amino_Acid_Distribution | |
|
|
|
Peptide Physicochemical
| Molecular_Weight | 878.85 |
|---|---|
| Aliphatic_Index | 11.11111 |
| Aromaticity | 0.11111 |
| Average_Rotatable_Bonds | 2.88889 |
| Charge_at_pH_7 | -2.00064 |
| Isoelectric_Point | 3.55007 |
|---|---|
| Hydrogen_Bond_Acceptors | 14 |
| Hydrogen_Bond_Donors | 14 |
| Topological_Polar_Surface_Area | 420.05000 |
| X_logP_energy | -6.22130 |
Interaction Information
| Affinity | KD=80 uM |
|---|---|
| Affinity_Assay | NMR spectroscopy |
| PDB_ID | None |
| Type | Affinity ligand |
| Structure | |
Reference Information
| Document_Type | Research Articles |
|---|---|
| Title | Characterization of the APLF FHA-XRCC1 phosphopeptide interaction and its structural and functional implications. |
| Release_Year | 2017 |
| PMID | 29059378 |
| DOI | 10.1093/nar/gkx941 |