PPIRE09025
Target Protein Information
| Protein_Name | Aurora kinase A |
|---|---|
| Protein_Sequence | MDRSKENCISGPVKATAPVGGPKRVLVTQQFPCQNPLPVNSGQAQRVLCPSNSSQRIPLQAQKLVSSHKPVQNQKQKQLQATSVPHPVSRPLNNTQKSKQPLPSAPENNPEEELASKQKNEESKKRQWALEDFEIGRPLGKGKFGNVYLAREKQSKFILALKVLFKAQLEKAGVEHQLRREVEIQSHLRHPNILRLYGYFHDATRVYLILEYAPLGTVYRELQKLSKFDEQRTATYITELANALSYCHSKRVIHRDIKPENLLLGSAGELKIADFGWSVHAPSSRRTTLCGTLDYLPPEMIEGRMHDEKVDLWSLGVLCYEFLVGKPPFEANTYQETYKRISRVEFTFPDFVTEGARDLISRLLKHNPSQRPMLREVLEHPWITANSSKPSNCQNKESASKQS |
| Organism_Source | Homo sapiens |
| Functional_Classification | kinases |
| Cellular_Localization | Cytoplasm |
| Gene_Names | AURKA |
| UniProt_ID | O14965 |
| Protein-Protein Interaction Networks | |
Peptide Basic Information
| Peptide_Name | CPRFLPWC peptide |
|---|---|
| Peptide_Sequence | CPRFLPWCG |
| Peptide_Length | 9 |
| Peptide_SMILES | CC(C)C[C@H](NC(=O)[C@H](Cc1ccccc1)NC(=O)[C@H](CCCNC(=N)N)NC(=O)[C@@H]1CCCN1C(=O)[C@@H](N)CS)C(=O)N1CCC[C@H]1C(=O)N[C@@H](Cc1c[nH]c2ccccc12)C(=O)N[C@@H](CS)C(=O)NCC(=O)O |
| Chemical_Modification | None |
| Cyclization_Method | side chain-side chain cyclization; C1<->C8; disulfide bond |
| Linear/Cyclic | Cyclic |
| N-terminal_Modification | Free |
| C-terminal_Modification | amide |
| Amino_Acid_Distribution | |
|
|
|
Peptide Physicochemical
| Molecular_Weight | 1078.31 |
|---|---|
| Aliphatic_Index | 43.33333 |
| Aromaticity | 0.22222 |
| Average_Rotatable_Bonds | 3.00000 |
| Charge_at_pH_7 | 0.87403 |
| Isoelectric_Point | 8.23141 |
|---|---|
| Hydrogen_Bond_Acceptors | 13 |
| Hydrogen_Bond_Donors | 14 |
| Topological_Polar_Surface_Area | 356.23000 |
| X_logP_energy | -0.94383 |
Interaction Information
| Affinity | IC50=6.2 uM |
|---|---|
| Affinity_Assay | Enzyme Inhibition Kinetics |
| PDB_ID | None |
| Type | Inhibitor |
| Structure | |
Reference Information
| Document_Type | Research Articles |
|---|---|
| Title | Selection of cyclic-peptide inhibitors targeting Aurora kinase A: problems and solutions. |
| Release_Year | 2011 |
| PMID | 22004849 |
| DOI | 10.1016/j.bmc.2011.09.049 |