PPIRE09082
Target Protein Information
| Protein_Name | Growth factor receptor-bound protein 7 |
|---|---|
| Protein_Sequence | MELDLSPPHLSSSPEDLCPAPGTPPGTPRPPDTPLPEEVKRSQPLLIPTTGRKLREEERRATSLPSIPNPFPELCSPPSQSPILGGPSSARGLLPRDASRPHVVKVYSEDGACRSVEVAAGATARHVCEMLVQRAHALSDETWGLVECHPHLALERGLEDHESVVEVQAAWPVGGDSRFVFRKNFAKYELFKSSPHSLFPEKMVSSCLDAHTGISHEDLIQNFLNAGSFPEIQGFLQLRGSGRKLWKRFFCFLRRSGLYYSTKGTSKDPRHLQYVADVNESNVYVVTQGRKLYGMPTDFGFCVKPNKLRNGHKGLRIFCSEDEQSRTCWLAAFRLFKYGVQLYKNYQQAQSRHLHPSCLGSPPLRSASDNTLVAMDFSGHAGRVIENPREALSVALEEAQAWRKKTNHRLSLPMPASGTSLSAAIHRTQLWFHGRISREESQRLIGQQGLVDGLFLVRESQRNPQGFVLSLCHLQKVKHYLILPSEEEGRLYFSMDDGQTRFTDLLQLVEFHQLNRGILPCLLRHCCTRVAL |
| Organism_Source | Homo sapiens |
| Functional_Classification | SH2 domain |
| Cellular_Localization | Cytoplasm |
| Gene_Names | GRB7 |
| UniProt_ID | Q14451 |
| Protein-Protein Interaction Networks | |
Peptide Basic Information
| Peptide_Name | G7-B4 |
|---|---|
| Peptide_Sequence | XFEGYDNXC |
| Peptide_Length | 9 |
| Peptide_SMILES | NCC(=O)N[C@@H](Cc1ccccc1)C(=O)N[C@@H](CCC(=O)O)C(=O)NCC(=O)N[C@@H](Cc1ccc(O)cc1)C(=O)N[C@@H](CC(=O)O)C(=O)N[C@@H](CC(N)=O)C(=O)NCC(=O)N[C@@H](CS)C(=O)O |
| Chemical_Modification | X1=O-allylserine; X8=O-allylserine |
| Cyclization_Method | Multi-point cyclization; X1<->X8; other bonds; X1<->C9; other bonds |
| Linear/Cyclic | Cyclic |
| N-terminal_Modification | Free |
| C-terminal_Modification | amide |
| Amino_Acid_Distribution | |
|
|
|
Peptide Physicochemical
| Molecular_Weight | 960.97 |
|---|---|
| Aliphatic_Index | 0.00000 |
| Aromaticity | 0.22222 |
| Average_Rotatable_Bonds | 3.22222 |
| Charge_at_pH_7 | -2.06262 |
| Isoelectric_Point | 3.55007 |
|---|---|
| Hydrogen_Bond_Acceptors | 15 |
| Hydrogen_Bond_Donors | 15 |
| Topological_Polar_Surface_Area | 434.04000 |
| X_logP_energy | -5.49340 |
Interaction Information
| Affinity | KD=0.83 uM |
|---|---|
| Affinity_Assay | Surface plasmon resonance |
| PDB_ID | 5EEL |
| Type | Inhibitor |
| Structure | |
Reference Information
| Document_Type | Research Articles |
|---|---|
| Title | Unexpected involvement of staple leads to redesign of selective bicyclic peptide inhibitor of Grb7. |
| Release_Year | 2016 |
| PMID | 27257138 |
| DOI | 10.1038/srep27060 |