PPIRE09250
Target Protein Information
| Protein_Name | Inhibitor of growth protein 4 |
|---|---|
| Protein_Sequence | MAAGMYLEHYLDSIENLPFELQRNFQLMRDLDQRTEDLKAEIDKLATEYMSSARSLSSEEKLALLKQIQEAYGKCKEFGDDKVQLAMQTYEMVDKHIRRLDTDLARFEADLKEKQIESSDYDSSSSKGKKKGRTQKEKKAARARSKGKNSDEEAPKTAQKKLKLVRTSPEYGMPSVTFGSVHPSDVLDMPVDPNEPTYCLCHQVSYGEMIGCDNPDCSIEWFHFACVGLTTKPRGKWFCPRCSQERKKK |
| Organism_Source | Homo sapiens |
| Functional_Classification | PHD finger |
| Cellular_Localization | Nucleus |
| Gene_Names | ING4 |
| UniProt_ID | Q9UNL4 |
| Protein-Protein Interaction Networks | |
Peptide Basic Information
| Peptide_Name | H3(1-10)K4me2 |
|---|---|
| Peptide_Sequence | ARTKQTARKS |
| Peptide_Length | 10 |
| Peptide_SMILES | C[C@H](N)C(=O)N[C@@H](CCCNC(=N)N)C(=O)N[C@H](C(=O)N[C@@H](CCCCN)C(=O)N[C@@H](CCC(N)=O)C(=O)N[C@H](C(=O)N[C@@H](C)C(=O)N[C@@H](CCCNC(=N)N)C(=O)N[C@@H](CCCCN)C(=O)N[C@@H](CO)C(=O)O)[C@@H](C)O)[C@@H](C)O |
| Chemical_Modification | |
| Cyclization_Method | |
| Linear/Cyclic | Linear |
| N-terminal_Modification | Free |
| C-terminal_Modification | Free |
| Amino_Acid_Distribution | |
|
|
|
Peptide Physicochemical
| Molecular_Weight | 1146.32 |
|---|---|
| Aliphatic_Index | 20.00000 |
| Aromaticity | 0.00000 |
| Average_Rotatable_Bonds | 4.10000 |
| Charge_at_pH_7 | 3.99739 |
| Isoelectric_Point | 12.53175 |
|---|---|
| Hydrogen_Bond_Acceptors | 19 |
| Hydrogen_Bond_Donors | 23 |
| Topological_Polar_Surface_Area | 604.84000 |
| X_logP_energy | -9.39476 |
Interaction Information
| Affinity | KD=9.7 uM |
|---|---|
| Affinity_Assay | Isothermal titration calorimetry |
| PDB_ID | 2VNF |
| Type | Affinity ligand |
| Structure | |
Reference Information
| Document_Type | Research Articles |
|---|---|
| Title | Molecular basis of histone H3K4me3 recognition by ING4. |
| Release_Year | 2008 |
| PMID | 18381289 |
| DOI | 10.1074/jbc.M710020200 |