PPIRE09311
Target Protein Information
| Protein_Name | PDCD10 and GCKIII kinases-associated protein 1 |
|---|---|
| Protein_Sequence | MGCRCCKIIQSYLFDPVQVPSPGYVNEVNSCKLDEDDTDKLKGKWSSEVLVQKNDPQRQGSKKTESSSRTADPWEPCWPHQGPLPQGDAGGEHHACGVNGIGPAATPQPTGNSSPTQDDRGSWASTANTVPPTQPFLEGGGTRKQDCVLLASEGTQVMRNGDSRAPSEAESFALEVQDHVFQIPAPDYLQHWGPAGDNVDHNEKDCVFKNHTEDESLEGIQPPVGEHGLNTPFSVRRSWDSLNEDVETEVLSICFNEKGPVHAMPVVDSGNRQEDTHGSDGDGDGEIVDEDAAVAEALAALEAATAGEDLDETD |
| Organism_Source | Homo sapiens |
| Functional_Classification | scaffolding proteins |
| Cellular_Localization | Cytoplasm |
| Gene_Names | PGCKA1 |
| UniProt_ID | Q8IY42 |
| Protein-Protein Interaction Networks | |
Peptide Basic Information
| Peptide_Name | paxillin LD1 |
|---|---|
| Peptide_Sequence | DALLADLEST |
| Peptide_Length | 10 |
| Peptide_SMILES | CC(C)C[C@H](NC(=O)[C@H](C)NC(=O)[C@@H](N)CC(=O)O)C(=O)N[C@@H](CC(C)C)C(=O)N[C@@H](C)C(=O)N[C@@H](CC(=O)O)C(=O)N[C@@H](CC(C)C)C(=O)N[C@@H](CCC(=O)O)C(=O)N[C@@H](CO)C(=O)N[C@H](C(=O)O)[C@@H](C)O |
| Chemical_Modification | None |
| Cyclization_Method | None |
| Linear/Cyclic | Linear |
| N-terminal_Modification | Free |
| C-terminal_Modification | Free |
| Amino_Acid_Distribution | |
|
|
|
Peptide Physicochemical
| Molecular_Weight | 1047.13 |
|---|---|
| Aliphatic_Index | 137.00000 |
| Aromaticity | 0.00000 |
| Average_Rotatable_Bonds | 3.40000 |
| Charge_at_pH_7 | -2.99935 |
| Isoelectric_Point | 3.38003 |
|---|---|
| Hydrogen_Bond_Acceptors | 16 |
| Hydrogen_Bond_Donors | 16 |
| Topological_Polar_Surface_Area | 477.58000 |
| X_logP_energy | -4.87310 |
Interaction Information
| Affinity | KD=17 uM |
|---|---|
| Affinity_Assay | Surface plasmon resonance |
| PDB_ID | 3RQE |
| Type | Affinity ligand |
| Structure | |
Reference Information
| Document_Type | Research Articles |
|---|---|
| Title | Molecular recognition of leucine-aspartate repeat (LD)motifs by the focal adhesion targeting homology domain of cerebral cavernous malformation 3 (CCM3). |
| Release_Year | 2011 |
| PMID | 21632544 |
| DOI | 10.1074/jbc.M110.211250 |