PPIRE09347
Target Protein Information
| Protein_Name | Peptidyl-prolyl cis-trans isomerase FKBP8 |
|---|---|
| Protein_Sequence | MASCAEPSEPSAPLPAGVPPLEDFEVLDGVEDAEGEEEEEEEEEEEDDLSELPPLEDMGQPPAEEAEQPGALAREFLAAMEPEPAPAPAPEEWLDILGNGLLRKKTLVPGPPGSSRPVKGQVVTVHLQTSLENGTRVQEEPELVFTLGDCDVIQALDLSVPLMDVGETAMVTADSKYCYGPQGRSPYIPPHAALCLEVTLKTAVDGPDLEMLTGQERVALANRKRECGNAHYQRADFVLAANSYDLAIKAITSSAKVDMTFEEEAQLLQLKVKCLNNLAASQLKLDHYRAALRSCSLVLEHQPDNIKALFRKGKVLAQQGEYSEAIPILRAALKLEPSNKTIHAELSKLVKKHAAQRSTETALYRKMLGNPSRLPAKCPGKGAWSIPWKWLFGATAVALGGVALSVVIAARN |
| Organism_Source | Homo sapiens |
| Functional_Classification | peptidyl-prolyl isomerases |
| Cellular_Localization | Cytoplasm |
| Gene_Names | FKBP8 |
| UniProt_ID | Q14318 |
| Protein-Protein Interaction Networks | |
Peptide Basic Information
| Peptide_Name | Hsp90beta EDASRMEEVD peptide |
|---|---|
| Peptide_Sequence | EDASRMEEVD |
| Peptide_Length | 10 |
| Peptide_SMILES | CSCC[C@H](NC(=O)[C@H](CCCNC(=N)N)NC(=O)[C@H](CO)NC(=O)[C@H](C)NC(=O)[C@H](CC(=O)O)NC(=O)[C@@H](N)CCC(=O)O)C(=O)N[C@@H](CCC(=O)O)C(=O)N[C@@H](CCC(=O)O)C(=O)N[C@H](C(=O)N[C@@H](CC(=O)O)C(=O)O)C(C)C |
| Chemical_Modification | None |
| Cyclization_Method | None |
| Linear/Cyclic | Linear |
| N-terminal_Modification | Free |
| C-terminal_Modification | Free |
| Amino_Acid_Distribution | |
|
|
|
Peptide Physicochemical
| Molecular_Weight | 1180.21 |
|---|---|
| Aliphatic_Index | 39.00000 |
| Aromaticity | 0.00000 |
| Average_Rotatable_Bonds | 4.10000 |
| Charge_at_pH_7 | -3.99580 |
| Isoelectric_Point | 3.63840 |
|---|---|
| Hydrogen_Bond_Acceptors | 19 |
| Hydrogen_Bond_Donors | 20 |
| Topological_Polar_Surface_Area | 593.85000 |
| X_logP_energy | -7.01013 |
Interaction Information
| Affinity | KD=64.5 uM |
|---|---|
| Affinity_Assay | Isothermal titration calorimetry |
| PDB_ID | None |
| Type | Affinity ligand |
| Structure | |
Reference Information
| Document_Type | Research Articles |
|---|---|
| Title | The structure of FKBP38 in complex with the MEEVD tetratricopeptide binding-motif of Hsp90. |
| Release_Year | 2017 |
| PMID | 28278223 |
| DOI | 10.1371/journal.pone.0173543 |