PPIRE09746
Target Protein Information
| Protein_Name | C5a anaphylatoxin chemotactic receptor 1 |
|---|---|
| Protein_Sequence | MDSFNYTTPDYGHYDDKDTLDLNTPVDKTSNTLRVPDILALVIFAVVFLVGVLGNALVVWVTAFEAKRTINAIWFLNLAVADFLSCLALPILFTSIVQHHHWPFGGAACSILPSLILLNMYASILLLATISADRFLLVFKPIWCQNFRGAGLAWIACAVAWGLALLLTIPSFLYRVVREEYFPPKVLCGVDYSHDKRRERAVAIVRLVLGFLWPLLTLTICYTFILLRTWSRRATRSTKTLKVVVAVVASFFIFWLPYQVTGIMMSFLEPSSPTFLLLKKLDSLCVSFAYINCCINPIIYVVAGQGFQGRLRKSLPSLLRNVLTEESVVRESKSFTRSTVDTMAQKTQAV |
| Organism_Source | Homo sapiens |
| Functional_Classification | G protein-coupled receptor |
| Cellular_Localization | Plasma membrane |
| Gene_Names | C5AR1 |
| UniProt_ID | P21730 |
| Protein-Protein Interaction Networks | |
Peptide Basic Information
| Peptide_Name | YSFKPMPLaR |
|---|---|
| Peptide_Sequence | YSFKPMPLaR |
| Peptide_Length | 10 |
| Peptide_SMILES | CSCC[C@H](NC(=O)[C@@H]1CCCN1C(=O)[C@H](CCCCN)NC(=O)[C@H](Cc1ccccc1)NC(=O)[C@H](CO)NC(=O)[C@@H](N)Cc1ccc(O)cc1)C(=O)N1CCC[C@H]1C(=O)N[C@@H](CC(C)C)C(=O)N[C@@H](C)C(=O)N[C@@H](CCCNC(=N)N)C(=O)O |
| Chemical_Modification | None |
| Cyclization_Method | None |
| Linear/Cyclic | Linear |
| N-terminal_Modification | Free |
| C-terminal_Modification | Free |
| Amino_Acid_Distribution | |
|
|
|
Peptide Physicochemical
| Molecular_Weight | 1209.47 |
|---|---|
| Aliphatic_Index | 49.00000 |
| Aromaticity | 0.20000 |
| Average_Rotatable_Bonds | 3.50000 |
| Charge_at_pH_7 | 1.99684 |
| Isoelectric_Point | 10.45492 |
|---|---|
| Hydrogen_Bond_Acceptors | 16 |
| Hydrogen_Bond_Donors | 15 |
| Topological_Polar_Surface_Area | 436.02000 |
| X_logP_energy | -1.83143 |
Interaction Information
| Affinity | Ki=2.75 uM |
|---|---|
| Affinity_Assay | molecular docking |
| PDB_ID | None |
| Type | Agonist |
| Structure | |
Reference Information
| Document_Type | Research Articles |
|---|---|
| Title | Model structures of inactive and peptide agonist bound C5aR: Insights into agonist binding, selectivity and activation. |
| Release_Year | 2015 |
| PMID | 29124137 |
| DOI | 10.1016/j.bbrep.2015.03.002 |