PPIRE09754
Target Protein Information
| Protein_Name | Urokinase-type plasminogen activator |
|---|---|
| Protein_Sequence | MKVWLASLFLCALVVKNSEGGSVLGAPDESNCGCQNGGVCVSYKYFSRIRRCSCPRKFQGEHCEIDASKTCYHGNGDSYRGKANTDTKGRPCLAWNAPAVLQKPYNAHRPDAISLGLGKHNYCRNPDNQKRPWCYVQIGLRQFVQECMVHDCSLSKKPSSSVDQQGFQCGQKALRPRFKIVGGEFTEVENQPWFAAIYQKNKGGSPPSFKCGGSLISPCWVASAAHCFIQLPKKENYVVYLGQSKESSYNPGEMKFEVEQLILHEYYREDSLAYHNDIALLKIRTSTGQCAQPSRSIQTICLPPRFTDAPFGSDCEITGFGKESESDYLYPKNLKMSVVKLVSHEQCMQPHYYGSEINYKMLCAADPEWKTDSCKGDSGGPLICNIEGRPTLSGIVSWGRGCAEKNKPGVYTRVSHFLDWIQSHIGEEKGLAF |
| Organism_Source | Mus musculus |
| Functional_Classification | serine protease |
| Cellular_Localization | Extracellular |
| Gene_Names | Plau |
| UniProt_ID | P06869 |
| Protein-Protein Interaction Networks | |
Peptide Basic Information
| Peptide_Name | mupain-1-IG |
|---|---|
| Peptide_Sequence | CPAYSRYIGC |
| Peptide_Length | 10 |
| Peptide_SMILES | CC[C@H](C)[C@H](NC(=O)[C@H](Cc1ccc(O)cc1)NC(=O)[C@H](CCCNC(=N)N)NC(=O)[C@H](CO)NC(=O)[C@H](Cc1ccc(O)cc1)NC(=O)[C@H](C)NC(=O)[C@@H]1CCCN1C(=O)[C@@H](N)CS)C(=O)NCC(=O)N[C@@H](CS)C(=O)O |
| Chemical_Modification | None |
| Cyclization_Method | Side chain-side chain cyclization; C1<->C10; disulfide bond |
| Linear/Cyclic | Cyclic |
| N-terminal_Modification | Free |
| C-terminal_Modification | Free |
| Amino_Acid_Distribution | |
|
|
|
Peptide Physicochemical
| Molecular_Weight | 1132.32 |
|---|---|
| Aliphatic_Index | 49.00000 |
| Aromaticity | 0.20000 |
| Average_Rotatable_Bonds | 3.10000 |
| Charge_at_pH_7 | 0.87233 |
| Isoelectric_Point | 8.21452 |
|---|---|
| Hydrogen_Bond_Acceptors | 17 |
| Hydrogen_Bond_Donors | 18 |
| Topological_Polar_Surface_Area | 439.02000 |
| X_logP_energy | -4.02313 |
Interaction Information
| Affinity | Ki=10 nM |
|---|---|
| Affinity_Assay | Enzyme Inhibition Kinetics |
| PDB_ID | None |
| Type | Inhibitor |
| Structure | |
Reference Information
| Document_Type | Research Articles |
|---|---|
| Title | Selection of High-Affinity Peptidic Serine Protease Inhibitors with Increased Binding Entropy from a Back-Flip Library of Peptide-Protease Fusions. |
| Release_Year | 2015 |
| PMID | 26281711 |
| DOI | 10.1016/j.jmb.2015.08.005 |