PPIRE09761
Target Protein Information
| Protein_Name | Urokinase-type plasminogen activator |
|---|---|
| Protein_Sequence | MKVWLASLFLCALVVKNSEGGSVLGAPDESNCGCQNGGVCVSYKYFSRIRRCSCPRKFQGEHCEIDASKTCYHGNGDSYRGKANTDTKGRPCLAWNAPAVLQKPYNAHRPDAISLGLGKHNYCRNPDNQKRPWCYVQIGLRQFVQECMVHDCSLSKKPSSSVDQQGFQCGQKALRPRFKIVGGEFTEVENQPWFAAIYQKNKGGSPPSFKCGGSLISPCWVASAAHCFIQLPKKENYVVYLGQSKESSYNPGEMKFEVEQLILHEYYREDSLAYHNDIALLKIRTSTGQCAQPSRSIQTICLPPRFTDAPFGSDCEITGFGKESESDYLYPKNLKMSVVKLVSHEQCMQPHYYGSEINYKMLCAADPEWKTDSCKGDSGGPLICNIEGRPTLSGIVSWGRGCAEKNKPGVYTRVSHFLDWIQSHIGEEKGLAF |
| Organism_Source | Mus musculus |
| Functional_Classification | serine proteases |
| Cellular_Localization | Extracellular |
| Gene_Names | Plau |
| UniProt_ID | P06869 |
| Protein-Protein Interaction Networks | |
Peptide Basic Information
| Peptide_Name | mupain-1 |
|---|---|
| Peptide_Sequence | CPAYSRYLDC |
| Peptide_Length | 10 |
| Peptide_SMILES | CC(C)C[C@H](NC(=O)[C@H](Cc1ccc(O)cc1)NC(=O)[C@H](CCCNC(=N)N)NC(=O)[C@H](CO)NC(=O)[C@H](Cc1ccc(O)cc1)NC(=O)[C@H](C)NC(=O)[C@@H]1CCCN1C(=O)[C@@H](N)CS)C(=O)N[C@@H](CC(=O)O)C(=O)N[C@@H](CS)C(=O)O |
| Chemical_Modification | None |
| Cyclization_Method | Side chain-side chain cyclization; C1<->C10; disulfide bond |
| Linear/Cyclic | Cyclic |
| N-terminal_Modification | Free |
| C-terminal_Modification | Free |
| Amino_Acid_Distribution | |
|
|
|
Peptide Physicochemical
| Molecular_Weight | 1190.35 |
|---|---|
| Aliphatic_Index | 49.00000 |
| Aromaticity | 0.20000 |
| Average_Rotatable_Bonds | 3.30000 |
| Charge_at_pH_7 | -0.12722 |
| Isoelectric_Point | 6.06069 |
|---|---|
| Hydrogen_Bond_Acceptors | 18 |
| Hydrogen_Bond_Donors | 19 |
| Topological_Polar_Surface_Area | 476.32000 |
| X_logP_energy | -4.17983 |
Interaction Information
| Affinity | Ki=0.41 uM |
|---|---|
| Affinity_Assay | Enzyme Inhibition Kinetics |
| PDB_ID | None |
| Type | Inhibitor |
| Structure | |
Reference Information
| Document_Type | Research Articles |
|---|---|
| Title | Distinctive binding modes and inhibitory mechanisms of two peptidic inhibitors of urokinase-type plasminogen activator with isomeric P1 residues. |
| Release_Year | 2015 |
| PMID | 25744057 |
| DOI | 10.1016/j.biocel.2015.02.016 |