PPIRE09837
Target Protein Information
| Protein_Name | Histone-lysine N-methyltransferase SETD7 |
|---|---|
| Protein_Sequence | MDSDDEMVEEAVEGHLDDDGLPHGFCTVTYSSTDRFEGNFVHGEKNGRGKFFFFDGSTLEGYYVDDALQGQGVYTYEDGGVLQGTYVDGELNGPAQEYDTDGRLIFKGQYKDNIRHGVCWIYYPDGGSLVGEVNEDGEMTGEKIAYVYPDERTALYGKFIDGEMIEGKLATLMSTEEGRPHFELMPGNSVYHFDKSTSSCISTNALLPDPYESERVYVAESLISSAGEGLFSKVAVGPNTVMSFYNGVRITHQEVDSRDWALNGNTLSLDEETVIDVPEPYNHVSKYCASLGHKANHSFTPNCIYDMFVHPRFGPIKCIRTLRAVEADEELTVAYGYDHSPPGKSGPEAPEWYQVELKAFQATQQK |
| Organism_Source | Homo sapiens |
| Functional_Classification | lysine methyltransferases |
| Cellular_Localization | Nucleus |
| Gene_Names | SETD7 |
| UniProt_ID | Q8WTS6 |
| Protein-Protein Interaction Networks | |
Peptide Basic Information
| Peptide_Name | TAF10-K189 |
|---|---|
| Peptide_Sequence | SKSKDRKYTL |
| Peptide_Length | 10 |
| Peptide_SMILES | CC(C)C[C@H](NC(=O)[C@@H](NC(=O)[C@H](Cc1ccc(O)cc1)NC(=O)[C@H](CCCCN)NC(=O)[C@H](CCCNC(=N)N)NC(=O)[C@H](CC(=O)O)NC(=O)[C@H](CCCCN)NC(=O)[C@H](CO)NC(=O)[C@H](CCCCN)NC(=O)[C@@H](N)CO)[C@@H](C)O)C(=O)O |
| Chemical_Modification | None |
| Cyclization_Method | None |
| Linear/Cyclic | Linear |
| N-terminal_Modification | Acetyl |
| C-terminal_Modification | amide |
| Amino_Acid_Distribution | |
|
|
|
Peptide Physicochemical
| Molecular_Weight | 1225.41 |
|---|---|
| Aliphatic_Index | 39.00000 |
| Aromaticity | 0.10000 |
| Average_Rotatable_Bonds | 4.40000 |
| Charge_at_pH_7 | 2.99669 |
| Isoelectric_Point | 10.63646 |
|---|---|
| Hydrogen_Bond_Acceptors | 20 |
| Hydrogen_Bond_Donors | 22 |
| Topological_Polar_Surface_Area | 583.40000 |
| X_logP_energy | -6.75373 |
Interaction Information
| Affinity | KD=4 uM |
|---|---|
| Affinity_Assay | Isothermal titration calorimetry |
| PDB_ID | 3M57 |
| Type | Affinity ligand |
| Structure | |
Reference Information
| Document_Type | Research Articles |
|---|---|
| Title | SET7/9 catalytic mutants reveal the role of active site water molecules in lysine multiple methylation. |
| Release_Year | 2010 |
| PMID | 20675860 |
| DOI | 10.1074/jbc.M110.114587 |