PPIRE09847
Target Protein Information
| Protein_Name | Serine endoprotease DegS |
|---|---|
| Protein_Sequence | MFVKLLRSVAIGLIVGAILLVAMPSLRSLNPLSTPQFDSTDETPASYNLAVRRAAPAVVNVYNRGLNTNSHNQLEIRTLGSGVIMDQRGYIITNKHVINDADQIIVALQDGRVFEALLVGSDSLTDLAVLKINATGGLPTIPINARRVPHIGDVVLAIGNPYNLGQTITQGIISATGRIGLNPTGRQNFLQTDASINHGNSGGALVNSLGELMGINTLSFDKSNDGETPEGIGFAIPFQLATKIMDKLIRDGRVIRGYIGIGGREIAPLHAQGGGIDQLQGIVVNEVSPDGPAANAGIQVNDLIISVDNKPAISALETMDQVAEIRPGSVIPVVVMRDDKQLTLQVTIQEYPATN |
| Organism_Source | Escherichia coli O157:H7 |
| Functional_Classification | serine proteases |
| Cellular_Localization | Extracellular |
| Gene_Names | degS |
| UniProt_ID | P0AEE4 |
| Protein-Protein Interaction Networks | |
Peptide Basic Information
| Peptide_Name | YQF peptide |
|---|---|
| Peptide_Sequence | DNRLGLVYQF |
| Peptide_Length | 10 |
| Peptide_SMILES | CC(C)C[C@H](NC(=O)CNC(=O)[C@H](CC(C)C)NC(=O)[C@H](CCCNC(=N)N)NC(=O)[C@H](CC(N)=O)NC(=O)[C@@H](N)CC(=O)O)C(=O)N[C@H](C(=O)N[C@@H](Cc1ccc(O)cc1)C(=O)N[C@@H](CCC(N)=O)C(=O)N[C@@H](Cc1ccccc1)C(=O)O)C(C)C |
| Chemical_Modification | None |
| Cyclization_Method | None |
| Linear/Cyclic | Linear |
| N-terminal_Modification | Free |
| C-terminal_Modification | Free |
| Amino_Acid_Distribution | |
|
|
|
Peptide Physicochemical
| Molecular_Weight | 1224.38 |
|---|---|
| Aliphatic_Index | 107.00000 |
| Aromaticity | 0.20000 |
| Average_Rotatable_Bonds | 3.90000 |
| Charge_at_pH_7 | -0.00242 |
| Isoelectric_Point | 6.33190 |
|---|---|
| Hydrogen_Bond_Acceptors | 16 |
| Hydrogen_Bond_Donors | 18 |
| Topological_Polar_Surface_Area | 530.83000 |
| X_logP_energy | -3.78903 |
Interaction Information
| Affinity | KD=53 uM |
|---|---|
| Affinity_Assay | Isothermal titration calorimetry |
| PDB_ID | 1SOZ |
| Type | Allosteric modulator |
| Structure | |
Reference Information
| Document_Type | Research Articles |
|---|---|
| Title | Regulation of the sigmaE stress response by DegS: how the PDZ domain keeps the protease inactive in the resting state and allows integration of different OMP-derived stress signals upon folding stress. |
| Release_Year | 2007 |
| PMID | 17938245 |
| DOI | 10.1101/gad.445307 |