PPIRE10078
Target Protein Information
| Protein_Name | ATP-dependent Clp protease adapter protein ClpS |
|---|---|
| Protein_Sequence | MGKTNDWLDFDQLAEEKVRDALKPPSMYKVILVNDDYTPMEFVIDVLQKFFSYDVERATQLMLAVHYQGKAICGVFTAEVAETKVAMVNKYARENEHPLLCTLEKA |
| Organism_Source | Escherichia coli (strain SE11) |
| Functional_Classification | adaptor proteins |
| Cellular_Localization | Cytoplasm |
| Gene_Names | clpS |
| UniProt_ID | B6I8V2 |
| Protein-Protein Interaction Networks | |
Peptide Basic Information
| Peptide_Name | Lpep |
|---|---|
| Peptide_Sequence | LVKSKATNLLY |
| Peptide_Length | 11 |
| Peptide_SMILES | CC(C)C[C@H](NC(=O)[C@H](CC(C)C)NC(=O)[C@H](CC(N)=O)NC(=O)[C@@H](NC(=O)[C@H](C)NC(=O)[C@H](CCCCN)NC(=O)[C@H](CO)NC(=O)[C@H](CCCCN)NC(=O)[C@@H](NC(=O)[C@@H](N)CC(C)C)C(C)C)[C@@H](C)O)C(=O)N[C@@H](Cc1ccc(O)cc1)C(=O)O |
| Chemical_Modification | None |
| Cyclization_Method | None |
| Linear/Cyclic | Linear |
| N-terminal_Modification | Free |
| C-terminal_Modification | Free |
| Amino_Acid_Distribution | |
|
|
|
Peptide Physicochemical
| Molecular_Weight | 1249.52 |
|---|---|
| Aliphatic_Index | 141.81818 |
| Aromaticity | 0.09091 |
| Average_Rotatable_Bonds | 3.81818 |
| Charge_at_pH_7 | 1.99654 |
| Isoelectric_Point | 10.24761 |
|---|---|
| Hydrogen_Bond_Acceptors | 18 |
| Hydrogen_Bond_Donors | 18 |
| Topological_Polar_Surface_Area | 510.14000 |
| X_logP_energy | -3.48470 |
Interaction Information
| Affinity | KD=4.8 uM |
|---|---|
| Affinity_Assay | Isothermal titration calorimetry |
| PDB_ID | None |
| Type | Affinity ligand |
| Structure | |
Reference Information
| Document_Type | Research Articles |
|---|---|
| Title | Structural basis of N-end rule substrate recognition in Escherichia coli by the ClpAP adaptor protein ClpS. |
| Release_Year | 2009 |
| PMID | 19373253 |
| DOI | 10.1038/embor.2009.62 |