PPIRE10109
Target Protein Information
| Protein_Name | Beta-secretase 1 |
|---|---|
| Protein_Sequence | MAQALPWLLLWMGAGVLPAHGTQHGIRLPLRSGLGGAPLGLRLPRETDEEPEEPGRRGSFVEMVDNLRGKSGQGYYVEMTVGSPPQTLNILVDTGSSNFAVGAAPHPFLHRYYQRQLSSTYRDLRKGVYVPYTQGKWEGELGTDLVSIPHGPNVTVRANIAAITESDKFFINGSNWEGILGLAYAEIARPDDSLEPFFDSLVKQTHVPNLFSLQLCGAGFPLNQSEVLASVGGSMIIGGIDHSLYTGSLWYTPIRREWYYEVIIVRVEINGQDLKMDCKEYNYDKSIVDSGTTNLRLPKKVFEAAVKSIKAASSTEKFPDGFWLGEQLVCWQAGTTPWNIFPVISLYLMGEVTNQSFRITILPQQYLRPVEDVATSQDDCYKFAISQSSTGTVMGAVIMEGFYVVFDRARKRIGFAVSACHVHDEFRTAAVEGPFVTLDMEDCGYNIPQTDESTLMTIAYVMAAICALFMLPLCLMVCQWRCLRCLRQQHDDFADDISLLK |
| Organism_Source | Homo sapiens |
| Functional_Classification | aspartic proteases |
| Cellular_Localization | Plasma membrane |
| Gene_Names | BACE1 |
| UniProt_ID | P56817 |
| Protein-Protein Interaction Networks | |
Peptide Basic Information
| Peptide_Name | Substrate IV |
|---|---|
| Peptide_Sequence | REEVNLDAEKR |
| Peptide_Length | 11 |
| Peptide_SMILES | CC(C)C[C@H](NC(=O)[C@H](CC(N)=O)NC(=O)[C@@H](NC(=O)[C@H](CCC(=O)O)NC(=O)[C@H](CCC(=O)O)NC(=O)[C@@H](N)CCCNC(=N)N)C(C)C)C(=O)N[C@@H](CC(=O)O)C(=O)N[C@@H](C)C(=O)N[C@@H](CCC(=O)O)C(=O)N[C@@H](CCCCN)C(=O)N[C@@H](CCCNC(=N)N)C(=O)O |
| Chemical_Modification | E2=5-(2-aminoethyl)amino-1-naphthalenesulfonic acid; K9=4-(4-dimethylaminophenylazo)benzoic acid |
| Cyclization_Method | None |
| Linear/Cyclic | Linear |
| N-terminal_Modification | Free |
| C-terminal_Modification | Free |
| Amino_Acid_Distribution | |
|
|
|
Peptide Physicochemical
| Molecular_Weight | 1358.47 |
|---|---|
| Aliphatic_Index | 70.90909 |
| Aromaticity | 0.00000 |
| Average_Rotatable_Bonds | 4.45455 |
| Charge_at_pH_7 | -0.99655 |
| Isoelectric_Point | 4.58762 |
|---|---|
| Hydrogen_Bond_Acceptors | 20 |
| Hydrogen_Bond_Donors | 24 |
| Topological_Polar_Surface_Area | 696.43000 |
| X_logP_energy | -7.43166 |
Interaction Information
| Affinity | Km=2.03 uM |
|---|---|
| Affinity_Assay | TR-FRET assay |
| PDB_ID | None |
| Type | Affinity ligand |
| Structure | |
Reference Information
| Document_Type | Research Articles |
|---|---|
| Title | Reprint of: Liquid chromatographic enzymatic studies with on-line Beta-secretase immobilized enzyme reactor and 4-(4-dimethylaminophenylazo)benzoic acid/5-[(2-aminoethyl)amino] naphthalene-1-sulfonic acid peptide as fluorogenic substrate. |
| Release_Year | 2014 |
| PMID | 24932540 |
| DOI | 10.1016/j.jchromb.2014.05.009 |