PPIRE10175
Target Protein Information
| Protein_Name | CD2 antigen cytoplasmic tail-binding protein 2 |
|---|---|
| Protein_Sequence | MPKRKVTFQGVGDEEDEDEIIVPKKKLVDPVAGSGGPGSRFKGKHSLDSDEEEDDDDGGSSKYDILASEDVEGQEAATLPSEGGVRITPFNLQEEMEEGHFDADGNYFLNRDAQIRDSWLDNIDWVKIRERPPGQRQASDSEEEDSLGQTSMSAQALLEGLLELLLPRETVAGALRRLGARGGGKGRKGPGQPSSPQRLDRLSGLADQMVARGNLGVYQETRERLAMRLKGLGCQTLGPHNPTPPPSLDMFAEELAEEELETPTPTQRGEAESRGDGLVDVMWEYKWENTGDAELYGPFTSAQMQTWVSEGYFPDGVYCRKLDPPGGQFYNSKRIDFDLYT |
| Organism_Source | Homo sapiens |
| Functional_Classification | adaptor proteins |
| Cellular_Localization | Cytoplasm |
| Gene_Names | CD2BP2 |
| UniProt_ID | O95400 |
| Protein-Protein Interaction Networks | |
Peptide Basic Information
| Peptide_Name | CD2 SHRPPPPGHRV peptide |
|---|---|
| Peptide_Sequence | SHRPPPPGHRV |
| Peptide_Length | 11 |
| Peptide_SMILES | CC(C)[C@H](NC(=O)[C@H](CCCNC(=N)N)NC(=O)[C@H](Cc1c[nH]cn1)NC(=O)CNC(=O)[C@@H]1CCCN1C(=O)[C@@H]1CCCN1C(=O)[C@@H]1CCCN1C(=O)[C@@H]1CCCN1C(=O)[C@H](CCCNC(=N)N)NC(=O)[C@H](Cc1c[nH]cn1)NC(=O)[C@@H](N)CO)C(=O)O |
| Chemical_Modification | None |
| Cyclization_Method | None |
| Linear/Cyclic | Linear |
| N-terminal_Modification | Free |
| C-terminal_Modification | Free |
| Amino_Acid_Distribution | |
|
|
|
Peptide Physicochemical
| Molecular_Weight | 1236.40 |
|---|---|
| Aliphatic_Index | 26.36364 |
| Aromaticity | 0.00000 |
| Average_Rotatable_Bonds | 2.81818 |
| Charge_at_pH_7 | 2.17980 |
| Isoelectric_Point | 12.50011 |
|---|---|
| Hydrogen_Bond_Acceptors | 17 |
| Hydrogen_Bond_Donors | 17 |
| Topological_Polar_Surface_Area | 520.55000 |
| X_logP_energy | -5.99106 |
Interaction Information
| Affinity | KD=190 uM |
|---|---|
| Affinity_Assay | NMR titration |
| PDB_ID | 1L27 |
| Type | Affinity ligand |
| Structure | |
Reference Information
| Document_Type | Research Articles |
|---|---|
| Title | Peptides present in the non-digestible fraction of common beans (Phaseolus vulgaris L.)inhibit the angiotensin-I converting enzyme by interacting with its catalytic cavity independent of their antioxidant capacity. |
| Release_Year | 2002 |
| PMID | None |
| DOI | 10.1093/emboj/21.22.5985 |