PPIRE10490
Target Protein Information
| Protein_Name | Immunoglobulin heavy constant gamma 2B |
|---|---|
| Protein_Sequence | KTTPPSVYPLAPGCGDTTGSSVTLGCLVKGYFPESVTVTWNSGSLSSSVHTFPALLQSGLYTMSSSVTVPSSTWPSQTVTCSVAHPASSTTVDKKLEPSGPISTINPCPPCKECHKCPAPNLEGGPSVFIFPPNIKDVLMISLTPKVTCVVVDVSEDDPDVQISWFVNNVEVHTAQTQTHREDYNSTIRVVSTLPIQHQDWMSGKEFKCKVNNKDLPSPIERTISKIKGLVRAPQVYILPPPAEQLSRKDVSLTCLVVGFNPGDISVEWTSNGHTEENYKDTAPVLDSDGSYFIYSKLNMKTSKWEKTDSFSCNVRHEGLKNYYLKKTISRSPGLDLDDICAEAKDGELDGLWTTITIFISLFLLSVCYSASVTLFKVKWIFSSVVELKQKISPDYRNMIGQGA |
| Organism_Source | Mus musculus |
| Functional_Classification | IgG2b |
| Cellular_Localization | Extracellular |
| Gene_Names | Ighg2b |
| UniProt_ID | P01867 |
| Protein-Protein Interaction Networks | |
Peptide Basic Information
| Peptide_Name | BsRNaseY(79-90)peptide |
|---|---|
| Peptide_Sequence | ERRNELQKQENR |
| Peptide_Length | 12 |
| Peptide_SMILES | CC(C)C[C@H](NC(=O)[C@H](CCC(=O)O)NC(=O)[C@H](CC(N)=O)NC(=O)[C@H](CCCNC(=N)N)NC(=O)[C@H](CCCNC(=N)N)NC(=O)[C@@H](N)CCC(=O)O)C(=O)N[C@@H](CCC(N)=O)C(=O)N[C@@H](CCCCN)C(=O)N[C@@H](CCC(N)=O)C(=O)N[C@@H](CCC(=O)O)C(=O)N[C@@H](CC(N)=O)C(=O)N[C@@H](CCCNC(=N)N)C(=O)O |
| Chemical_Modification | None |
| Cyclization_Method | None |
| Linear/Cyclic | Linear |
| N-terminal_Modification | Free |
| C-terminal_Modification | Free |
| Amino_Acid_Distribution | |
|
|
|
Peptide Physicochemical
| Molecular_Weight | 1599.73 |
|---|---|
| Aliphatic_Index | 32.50000 |
| Aromaticity | 0.00000 |
| Average_Rotatable_Bonds | 5.00000 |
| Charge_at_pH_7 | 1.00300 |
| Isoelectric_Point | 9.68541 |
|---|---|
| Hydrogen_Bond_Acceptors | 24 |
| Hydrogen_Bond_Donors | 30 |
| Topological_Polar_Surface_Area | 879.40000 |
| X_logP_energy | -11.42779 |
Interaction Information
| Affinity | KD=0.36 nM |
|---|---|
| Affinity_Assay | ELISA |
| PDB_ID | 6F7T |
| Type | Affinity ligand |
| Structure | |
Reference Information
| Document_Type | Research Articles |
|---|---|
| Title | Dissociation of the Dimer of the Intrinsically Disordered Domain of RNase Y upon Antibody Binding. |
| Release_Year | 2018 |
| PMID | 30447990 |
| DOI | 10.1016/j.bpj.2018.10.016 |