PPIRE10544
Target Protein Information
| Protein_Name | WD repeat-containing protein 5 |
|---|---|
| Protein_Sequence | MATEEKKPETEAARAQPTPSSSATQSKPTPVKPNYALKFTLAGHTKAVSSVKFSPNGEWLASSSADKLIKIWGAYDGKFEKTISGHKLGISDVAWSSDSNLLVSASDDKTLKIWDVSSGKCLKTLKGHSNYVFCCNFNPQSNLIVSGSFDESVRIWDVKTGKCLKTLPAHSDPVSAVHFNRDGSLIVSSSYDGLCRIWDTASGQCLKTLIDDDNPPVSFVKFSPNGKYILAATLDNTLKLWDYSKGKCLKTYTGHKNEKYCIFANFSVTGGKWIVSGSEDNLVYIWNLQTKEIVQKLQGHTDVVISTACHPTENIIASAALENDKTIKLWKSDC |
| Organism_Source | Homo sapiens |
| Functional_Classification | WD-repeat proteins |
| Cellular_Localization | Nucleus |
| Gene_Names | WDR5 |
| UniProt_ID | P61964 |
| Protein-Protein Interaction Networks | |
Peptide Basic Information
| Peptide_Name | MLL1 Win peptide |
|---|---|
| Peptide_Sequence | GSARAEVHLRKS |
| Peptide_Length | 12 |
| Peptide_SMILES | CC(C)C[C@H](NC(=O)[C@H](Cc1c[nH]cn1)NC(=O)[C@@H](NC(=O)[C@H](CCC(=O)O)NC(=O)[C@H](C)NC(=O)[C@H](CCCNC(=N)N)NC(=O)[C@H](C)NC(=O)[C@H](CO)NC(=O)CN)C(C)C)C(=O)N[C@@H](CCCNC(=N)N)C(=O)N[C@@H](CCCCN)C(=O)N[C@@H](CO)C(=O)O |
| Chemical_Modification | None |
| Cyclization_Method | None |
| Linear/Cyclic | Linear |
| N-terminal_Modification | Acetyl |
| C-terminal_Modification | amide |
| Amino_Acid_Distribution | |
|
|
|
Peptide Physicochemical
| Molecular_Weight | 1310.48 |
|---|---|
| Aliphatic_Index | 73.33333 |
| Aromaticity | 0.00000 |
| Average_Rotatable_Bonds | 3.75000 |
| Charge_at_pH_7 | 2.09037 |
| Isoelectric_Point | 11.47971 |
|---|---|
| Hydrogen_Bond_Acceptors | 20 |
| Hydrogen_Bond_Donors | 24 |
| Topological_Polar_Surface_Area | 639.68000 |
| X_logP_energy | -8.42486 |
Interaction Information
| Affinity | KD=1.7 uM |
|---|---|
| Affinity_Assay | Isothermal titration calorimetry |
| PDB_ID | 3EG6 |
| Type | Inhibitor |
| Structure | |
Reference Information
| Document_Type | Research Articles |
|---|---|
| Title | Structure of WDR5 bound to mixed lineage leukemia protein-1 peptide. |
| Release_Year | 2008 |
| PMID | 18829459 |
| DOI | 10.1074/jbc.C800164200 |