PPIRE10554
Target Protein Information
| Protein_Name | UDP-N-acetylglucosamine 1-carboxyvinyltransferase |
|---|---|
| Protein_Sequence | MDKLIITGGNRLDGEIRISGAKNSALPILAATLLADTPVTVCNLPHLHDITTMIELFGRMGVQPIIDEKLNVEVDASSIKTLVAPYELVKTMRASILVLGPMLARFGEAEVALPGGCAIGSRPVDLHIRGLEAMGAQIEVEGGYIKAKAPVGGLHGGQFFFDTVSVTGTENLMMAAALANGRTVLQNAAREPEVVDLANCLNAMGANVQGAGSDTIVIDGVKRLGGARYDVLPDRIETGTYLVAAAATGGRVKLKDTDPTILEAVLQKLEEAGAHINTGNNWIELDMKGNRPKAVNIRTAPYPAFPTDMQAQFISMNAVAEGTGAVIETVFENRFMHVYEMNRMGAQILVEGNTAIVTGVPRLKGAPVMATDLRASASLVIAGLVAEGDTLIDRIYHIDRGYECIEEKLQLLGAKIRRVPG |
| Organism_Source | Pseudomonas aeruginosa (strain PA7) |
| Functional_Classification | transferases |
| Cellular_Localization | Cytoplasm |
| Gene_Names | murA |
| UniProt_ID | A6VBC3 |
| Protein-Protein Interaction Networks | |
Peptide Basic Information
| Peptide_Name | PEP 1354 |
|---|---|
| Peptide_Sequence | HESFWYLPHQSY |
| Peptide_Length | 12 |
| Peptide_SMILES | CC(C)C[C@H](NC(=O)[C@H](Cc1ccc(O)cc1)NC(=O)[C@H](Cc1c[nH]c2ccccc12)NC(=O)[C@H](Cc1ccccc1)NC(=O)[C@H](CO)NC(=O)[C@H](CCC(=O)O)NC(=O)[C@@H](N)Cc1c[nH]cn1)C(=O)N1CCC[C@H]1C(=O)N[C@@H](Cc1c[nH]cn1)C(=O)N[C@@H](CCC(N)=O)C(=O)N[C@@H](CO)C(=O)N[C@@H](Cc1ccc(O)cc1)C(=O)O |
| Chemical_Modification | |
| Cyclization_Method | |
| Linear/Cyclic | Linear |
| N-terminal_Modification | Free |
| C-terminal_Modification | Free |
| Amino_Acid_Distribution | |
|
|
|
Peptide Physicochemical
| Molecular_Weight | 1593.72 |
|---|---|
| Aliphatic_Index | 32.50000 |
| Aromaticity | 0.33333 |
| Average_Rotatable_Bonds | 3.66667 |
| Charge_at_pH_7 | -0.82012 |
| Isoelectric_Point | 6.49733 |
|---|---|
| Hydrogen_Bond_Acceptors | 21 |
| Hydrogen_Bond_Donors | 21 |
| Topological_Polar_Surface_Area | 609.09000 |
| X_logP_energy | -2.80680 |
Interaction Information
Reference Information
| Document_Type | Research Articles |
|---|---|
| Title | Computed insight into a peptide inhibitor preventing the induced fit mechanism of MurA enzyme from Pseudomonas aeruginosa. |
| Release_Year | 2016 |
| PMID | 27736019 |
| DOI | 10.1111/cbdd.12882 |