PPIRE10689
Target Protein Information
| Protein_Name | Calcium-binding protein 39 |
|---|---|
| Protein_Sequence | MPFPFGKSHKSPADIVKNLKESMAVLEKQDISDKKAEKATEEVSKNLVAMKEILYGTNEKEPQTEAVAQLAQELYNSGLLSTLVADLQLIDFEGKKDVAQIFNNILRRQIGTRTPTVEYICTQQNILFMLLKGYESPEIALNCGIMLRECIRHEPLAKIILWSEQFYDFFRYVEMSTFDIASDAFATFKDLLTRHKLLSAEFLEQHYDRFFSEYEKLLHSENYVTKRQSLKLLGELLLDRHNFTIMTKYISKPENLKLMMNLLRDKSRNIQFEAFHVFKVFVANPNKTQPILDILLKNQAKLIEFLSKFQNDRTEDEQFNDEKTYLVKQIRDLKRPAQQEA |
| Organism_Source | Homo sapiens |
| Functional_Classification | armadillo repeat proteins |
| Cellular_Localization | Cytoplasm |
| Gene_Names | CAB39 |
| UniProt_ID | Q9Y376 |
| Protein-Protein Interaction Networks | |
Peptide Basic Information
| Peptide_Name | STRADalpha C12 peptide |
|---|---|
| Peptide_Sequence | NLEELEVDDWEF |
| Peptide_Length | 12 |
| Peptide_SMILES | CC(C)C[C@H](NC(=O)[C@H](CCC(=O)O)NC(=O)[C@H](CCC(=O)O)NC(=O)[C@H](CC(C)C)NC(=O)[C@@H](N)CC(N)=O)C(=O)N[C@@H](CCC(=O)O)C(=O)N[C@H](C(=O)N[C@@H](CC(=O)O)C(=O)N[C@@H](CC(=O)O)C(=O)N[C@@H](Cc1c[nH]c2ccccc12)C(=O)N[C@@H](CCC(=O)O)C(=O)N[C@@H](Cc1ccccc1)C(=O)O)C(C)C |
| Chemical_Modification | None |
| Cyclization_Method | None |
| Linear/Cyclic | Linear |
| N-terminal_Modification | Biotinyl |
| C-terminal_Modification | Free |
| Amino_Acid_Distribution | |
|
|
|
Peptide Physicochemical
| Molecular_Weight | 1537.60 |
|---|---|
| Aliphatic_Index | 89.16667 |
| Aromaticity | 0.16667 |
| Average_Rotatable_Bonds | 4.16667 |
| Charge_at_pH_7 | -5.99402 |
| Isoelectric_Point | 3.16720 |
|---|---|
| Hydrogen_Bond_Acceptors | 20 |
| Hydrogen_Bond_Donors | 21 |
| Topological_Polar_Surface_Area | 666.10000 |
| X_logP_energy | -3.27000 |
Interaction Information
| Affinity | KD=400 nM |
|---|---|
| Affinity_Assay | Surface plasmon resonance |
| PDB_ID | 1UPL |
| Type | Affinity ligand |
| Structure | |
Reference Information
| Document_Type | Research Articles |
|---|---|
| Title | Crystal structure of MO25 alpha in complex with the C terminus of the pseudo kinase STE20-related adaptor. |
| Release_Year | 2004 |
| PMID | 14730349 |
| DOI | 10.1038/nsmb716 |