PPIRE10755
Target Protein Information
| Protein_Name | Bromodomain-containing protein 7 |
|---|---|
| Protein_Sequence | MGKKHKKHKSDKHLYEEYVEKPLKLVLKVGGNEVTELSTGSSGHDSSLFEDKNDHDKHKDRKRKKRKKGEKQIPGEEKGRKRRRVKEDKKKRDRDRVENEAEKDLQCHAPVRLDLPPEKPLTSSLAKQEEVEQTPLQEALNQLMRQLQRKDPSAFFSFPVTDFIAPGYSMIIKHPMDFSTMKEKIKNNDYQSIEELKDNFKLMCTNAMIYNKPETIYYKAAKKLLHSGMKILSQERIQSLKQSIDFMADLQKTRKQKDGTDTSQSGEDGGCWQREREDSGDAEAHAFKSPSKENKKKDKDMLEDKFKSNNLEREQEQLDRIVKESGGKLTRRLVNSQCEFERRKPDGTTTLGLLHPVDPIVGEPGYCPVRLGMTTGRLQSGVNTLQGFKEDKRNKVTPVLYLNYGPYSSYAPHYDSTFANISKDDSDLIYSTYGEDSDLPSDFSIHEFLATCQDYPYVMADSLLDVLTKGGHSRTLQEMEMSLPEDEGHTRTLDTAKEMEITEVEPPGRLDSSTQDRLIALKAVTNFGVPVEVFDSEEAEIFQKKLDETTRLLRELQEAQNERLSTRPPPNMICLLGPSYREMHLAEQVTNNLKELAQQVTPGDIVSTYGVRKAMGISIPSPVMENNFVDLTEDTEEPKKTDVAECGPGGS |
| Organism_Source | Homo sapiens |
| Functional_Classification | bromodomains |
| Cellular_Localization | Nucleus |
| Gene_Names | BRD7 |
| UniProt_ID | Q9NPI1 |
| Protein-Protein Interaction Networks | |
Peptide Basic Information
| Peptide_Name | H4 Ac-K8 |
|---|---|
| Peptide_Sequence | SGRGKGGXGLGK |
| Peptide_Length | 12 |
| Peptide_SMILES | CC(C)C[C@H](NC(=O)CNC(=O)CNC(=O)CNC(=O)CNC(=O)[C@H](CCCCN)NC(=O)CNC(=O)[C@H](CCCNC(=N)N)NC(=O)CNC(=O)[C@@H](N)CO)C(=O)NCC(=O)N[C@@H](CCCCN)C(=O)O |
| Chemical_Modification | X8=acetyllysine |
| Cyclization_Method | None |
| Linear/Cyclic | Linear |
| N-terminal_Modification | Free |
| C-terminal_Modification | Free |
| Amino_Acid_Distribution | |
|
|
|
Peptide Physicochemical
| Molecular_Weight | 1030.15 |
|---|---|
| Aliphatic_Index | 32.50000 |
| Aromaticity | 0.00000 |
| Average_Rotatable_Bonds | 3.16667 |
| Charge_at_pH_7 | 2.99739 |
| Isoelectric_Point | 11.82306 |
|---|---|
| Hydrogen_Bond_Acceptors | 17 |
| Hydrogen_Bond_Donors | 19 |
| Topological_Polar_Surface_Area | 517.59000 |
| X_logP_energy | -9.28943 |
Interaction Information
| Affinity | KD=1.79 mM |
|---|---|
| Affinity_Assay | NMR titration |
| PDB_ID | None |
| Type | Affinity ligand |
| Structure | |
Reference Information
| Document_Type | Research Articles |
|---|---|
| Title | Solution structure of BRD7 bromodomain and its interaction with acetylated peptides from histone H3 and H4. |
| Release_Year | 2007 |
| PMID | 17498659 |
| DOI | 10.1016/j.bbrc.2007.04.139 |