PPIRE11028
Target Protein Information
| Protein_Name | Myc proto-oncogene protein |
|---|---|
| Protein_Sequence | MDFFRVVENQQPPATMPLNVSFTNRNYDLDYDSVQPYFYCDEEENFYQQQQQSELQPPAPSEDIWKKFELLPTPPLSPSRRSGLCSPSYVAVTPFSLRGDNDGGGGSFSTADQLEMVTELLGGDMVNQSFICDPDDETFIKNIIIQDCMWSGFSAAAKLVSEKLASYQAARKDSGSPNPARGHSVCSTSSLYLQDLSAAASECIDPSVVFPYPLNDSSSPKSCASQDSSAFSPSSDSLLSSTESSPQGSPEPLVLHEETPPTTSSDSEEEQEDEEEIDVVSVEKRQAPGKRSESGSPSAGGHSKPPHSPLVLKRCHVSTHQHNYAAPPSTRKDYPAAKRVKLDSVRVLRQISNNRKCTSPRSSDTEENVKRRTHNVLERQRRNELKRSFFALRDQIPELENNEKAPKVVILKKATAYILSVQAEEQKLISEEDLLRKRREQLKHKLEQLRNSCA |
| Organism_Source | Homo sapiens |
| Functional_Classification | basic helix-loop-helix leucine zipper |
| Cellular_Localization | Nucleus |
| Gene_Names | MYC |
| UniProt_ID | P01106 |
| Protein-Protein Interaction Networks | |
Peptide Basic Information
| Peptide_Name | Myc-pT58 |
|---|---|
| Peptide_Sequence | FELLPpTPPLSPS |
| Peptide_Length | 13 |
| Peptide_SMILES | CC(C)C[C@H](NC(=O)[C@H](CCC(=O)O)NC(=O)[C@@H](N)Cc1ccccc1)C(=O)N[C@@H](CC(C)C)C(=O)N1CCC[C@H]1C(=O)N1CCC[C@H]1C(=O)N[C@H](C(=O)N1CCC[C@H]1C(=O)N1CCC[C@H]1C(=O)N[C@@H](CC(C)C)C(=O)N[C@@H](CO)C(=O)N1CCC[C@H]1C(=O)N[C@@H](CO)C(=O)O)[C@@H](C)O |
| Chemical_Modification | None |
| Cyclization_Method | None |
| Linear/Cyclic | Linear |
| N-terminal_Modification | Biotinylated |
| C-terminal_Modification | amide |
| Amino_Acid_Distribution | |
|
|
|
Peptide Physicochemical
| Molecular_Weight | 1394.63 |
|---|---|
| Aliphatic_Index | 90.00000 |
| Aromaticity | 0.07692 |
| Average_Rotatable_Bonds | 2.61538 |
| Charge_at_pH_7 | -1.00024 |
| Isoelectric_Point | 3.84998 |
|---|---|
| Hydrogen_Bond_Acceptors | 18 |
| Hydrogen_Bond_Donors | 13 |
| Topological_Polar_Surface_Area | 466.56000 |
| X_logP_energy | -2.64190 |
Interaction Information
| Affinity | KD=800 nM |
|---|---|
| Affinity_Assay | Surface plasmon resonance |
| PDB_ID | None |
| Type | Affinity ligand |
| Structure | |
Reference Information
| Document_Type | Research Articles |
|---|---|
| Title | Generating a recombinant phosphothreonine-binding domain for a phosphopeptide of the human transcription factor, c-Myc. |
| Release_Year | 2018 |
| PMID | 29763736 |
| DOI | 10.1016/j.nbt.2018.05.001 |