PPIRE11083
Target Protein Information
| Protein_Name | Retinoic acid receptor RXR-alpha |
|---|---|
| Protein_Sequence | MDTKHFLPLDFSTQVNSSLTSPTGRGSMAAPSLHPSLGPGIGSPGQLHSPISTLSSPINGMGPPFSVISSPMGPHSMSVPTTPTLGFSTGSPQLSSPMNPVSSSEDIKPPLGLNGVLKVPAHPSGNMASFTKHICAICGDRSSGKHYGVYSCEGCKGFFKRTVRKDLTYTCRDNKDCLIDKRQRNRCQYCRYQKCLAMGMKREAVQEERQRGKDRNENEVESTSSANEDMPVERILEAELAVEPKTETYVEANMGLNPSSPNDPVTNICQAADKQLFTLVEWAKRIPHFSELPLDDQVILLRAGWNELLIASFSHRSIAVKDGILLATGLHVHRNSAHSAGVGAIFDRVLTELVSKMRDMQMDKTELGCLRAIVLFNPDSKGLSNPAEVEALREKVYASLEAYCKHKYPEQPGRFAKLLLRLPALRSIGLKCLEHLFFFKLIGDTPIDTFLMEMLEAPHQMT |
| Organism_Source | Homo sapiens |
| Functional_Classification | nuclear receptors |
| Cellular_Localization | Nucleus |
| Gene_Names | RXRA |
| UniProt_ID | P19793 |
| Protein-Protein Interaction Networks | |
Peptide Basic Information
| Peptide_Name | GRIP-1 |
|---|---|
| Peptide_Sequence | KHKILHRLLQDSS |
| Peptide_Length | 13 |
| Peptide_SMILES | CC[C@H](C)[C@H](NC(=O)[C@H](CCCCN)NC(=O)[C@H](Cc1c[nH]cn1)NC(=O)[C@@H](N)CCCCN)C(=O)N[C@@H](CC(C)C)C(=O)N[C@@H](Cc1c[nH]cn1)C(=O)N[C@@H](CCCNC(=N)N)C(=O)N[C@@H](CC(C)C)C(=O)N[C@@H](CC(C)C)C(=O)N[C@@H](CCC(N)=O)C(=O)N[C@@H](CC(=O)O)C(=O)N[C@@H](CO)C(=O)N[C@@H](CO)C(=O)O |
| Chemical_Modification | None |
| Cyclization_Method | None |
| Linear/Cyclic | Linear |
| N-terminal_Modification | Free |
| C-terminal_Modification | Free |
| Amino_Acid_Distribution | |
|
|
|
Peptide Physicochemical
| Molecular_Weight | 1574.85 |
|---|---|
| Aliphatic_Index | 120.00000 |
| Aromaticity | 0.00000 |
| Average_Rotatable_Bonds | 4.30769 |
| Charge_at_pH_7 | 2.17966 |
| Isoelectric_Point | 10.78909 |
|---|---|
| Hydrogen_Bond_Acceptors | 23 |
| Hydrogen_Bond_Donors | 25 |
| Topological_Polar_Surface_Area | 704.67000 |
| X_logP_energy | -6.42203 |
Interaction Information
| Affinity | KD=0.55 uM |
|---|---|
| Affinity_Assay | Isothermal titration calorimetry |
| PDB_ID | 3OAP |
| Type | Allosteric modulator |
| Structure | |
Reference Information
| Document_Type | Research Articles |
|---|---|
| Title | Structure, energetics, and dynamics of binding coactivator peptide to the human retinoid X receptor Alpha ligand binding domain complex with 9-cis-retinoic acid. |
| Release_Year | 2011 |
| PMID | 21049972 |
| DOI | 10.1021/bi101288y |