PPIRE11093
Target Protein Information
| Protein_Name | Vitamin D3 receptor |
|---|---|
| Protein_Sequence | MEATAASTSLPDPGDFDRNVPRICGVCGDRATGFHFNAMTCEGCKGFFRRSMKRKALFTCPFNGDCRITKDNRRHCQACRLKRCVDIGMMKEFILTDEEVQRKREMIMKRKEEEALKDSLRPKLSEEQQHIIAILLDAHHKTYDPTYADFRDFRPPVRMDGSTGSYSPRPTLSFSGNSSSSSSDLYTTSLDMMEPSGFSNLDLNGEDSDDPSVTLDLSPLSMLPHLADLVSYSIQKVIGFAKMIPGFRDLTSDDQIVLLKSSAIEVIMLRSNQSFTMDDMSWDCGSQDYKYDVTDVSKAGHTLELIEPLIKFQVGLKKLNLHEEEHVLLMAICIVSPDRPGVQDAKLVEAIQDRLSNTLQTYIRCRHPPPGSHQLYAKMIQKLADLRSLNEEHSKQYRSLSFQPENSMKLTPLVLEVFGNEIS |
| Organism_Source | Rattus norvegicus |
| Functional_Classification | nuclear hormone receptors |
| Cellular_Localization | Nucleus |
| Gene_Names | Vdr |
| UniProt_ID | P13053 |
| Protein-Protein Interaction Networks | |
Peptide Basic Information
| Peptide_Name | DRIP205-2 |
|---|---|
| Peptide_Sequence | KNHPMLMNLLKDN |
| Peptide_Length | 13 |
| Peptide_SMILES | CSCC[C@H](NC(=O)[C@H](CC(C)C)NC(=O)[C@H](CCSC)NC(=O)[C@@H]1CCCN1C(=O)[C@H](Cc1c[nH]cn1)NC(=O)[C@H](CC(N)=O)NC(=O)[C@@H](N)CCCCN)C(=O)N[C@@H](CC(N)=O)C(=O)N[C@@H](CC(C)C)C(=O)N[C@@H](CC(C)C)C(=O)N[C@@H](CCCCN)C(=O)N[C@@H](CC(=O)O)C(=O)N[C@@H](CC(N)=O)C(=O)O |
| Chemical_Modification | None |
| Cyclization_Method | None |
| Linear/Cyclic | Linear |
| N-terminal_Modification | Free |
| C-terminal_Modification | amide |
| Amino_Acid_Distribution | |
|
|
|
Peptide Physicochemical
| Molecular_Weight | 1567.88 |
|---|---|
| Aliphatic_Index | 90.00000 |
| Aromaticity | 0.00000 |
| Average_Rotatable_Bonds | 4.15385 |
| Charge_at_pH_7 | 1.08875 |
| Isoelectric_Point | 9.53937 |
|---|---|
| Hydrogen_Bond_Acceptors | 23 |
| Hydrogen_Bond_Donors | 20 |
| Topological_Polar_Surface_Area | 651.02000 |
| X_logP_energy | -5.30870 |
Interaction Information
| Affinity | KD=9.4 uM |
|---|---|
| Affinity_Assay | Surface plasmon resonance |
| PDB_ID | None |
| Type | Allosteric modulator |
| Structure | |
Reference Information
| Document_Type | Research Articles |
|---|---|
| Title | SRC2-3 binds to vitamin D receptor with high sensitivity and strong affinity. |
| Release_Year | 2017 |
| PMID | 27890450 |
| DOI | 10.1016/j.bmc.2016.11.020 |