PPIRE11094
Target Protein Information
| Protein_Name | Protein BIM1 |
|---|---|
| Protein_Sequence | MSAGIGESRTELLTWLNGLLNLNYKKIEECGTGAAYCQIMDSIYGDLPMNRVKFNATAEYEFQTNYKILQSCFSRHGIEKTVYVDKLIRCKFQDNLEFLQWLKKHWIRHKDESVYDPDARRKYRPIITNNSATKPRTVSNPTTAKRSSSTGTGSAMSGGLATRHSSLGINGSRKTSVTQGQLVAIQAELTKSQETIGSLNEEIEQYKGTVSTLEIEREFYFNKLRDIEILVHTTQDLINEGVYKFNDETITGHGNGNGGALLRFVKKVESILYATAEGFEMNDGEDELNDKNLGEHGTVPNQGGYANSNGEVNGNEGSNHDVIMQNDEGEVGVSNNLIIDEETF |
| Organism_Source | Saccharomyces cerevisiae (strain ATCC 204508 / S288c) |
| Functional_Classification | microtubule plus-end tracking proteins |
| Cellular_Localization | Cytoplasm |
| Gene_Names | BIM1 |
| UniProt_ID | P40013 |
| Protein-Protein Interaction Networks | |
Peptide Basic Information
| Peptide_Name | SxIP peptide |
|---|---|
| Peptide_Sequence | KPSKIPTLQRKSW |
| Peptide_Length | 13 |
| Peptide_SMILES | CC[C@H](C)[C@H](NC(=O)[C@H](CCCCN)NC(=O)[C@H](CO)NC(=O)[C@@H]1CCCN1C(=O)[C@@H](N)CCCCN)C(=O)N1CCC[C@H]1C(=O)N[C@H](C(=O)N[C@@H](CC(C)C)C(=O)N[C@@H](CCC(N)=O)C(=O)N[C@@H](CCCNC(=N)N)C(=O)N[C@@H](CCCCN)C(=O)N[C@@H](CO)C(=O)N[C@@H](Cc1c[nH]c2ccccc12)C(=O)O)[C@@H](C)O |
| Chemical_Modification | None |
| Cyclization_Method | None |
| Linear/Cyclic | Linear |
| N-terminal_Modification | Free |
| C-terminal_Modification | Free |
| Amino_Acid_Distribution | |
|
|
|
Peptide Physicochemical
| Molecular_Weight | 1568.88 |
|---|---|
| Aliphatic_Index | 60.00000 |
| Aromaticity | 0.07692 |
| Average_Rotatable_Bonds | 3.92308 |
| Charge_at_pH_7 | 3.99710 |
| Isoelectric_Point | 11.92451 |
|---|---|
| Hydrogen_Bond_Acceptors | 22 |
| Hydrogen_Bond_Donors | 23 |
| Topological_Polar_Surface_Area | 654.47000 |
| X_logP_energy | -5.67433 |
Interaction Information
| Affinity | KD=13 uM |
|---|---|
| Affinity_Assay | Isothermal titration calorimetry |
| PDB_ID | None |
| Type | Affinity ligand |
| Structure | |
Reference Information
| Document_Type | Research Articles |
|---|---|
| Title | Structure-Function Relationship of the Bik1-Bim1 Complex. |
| Release_Year | 2018 |
| PMID | 29576319 |
| DOI | 10.1016/j.str.2018.03.003 |