PPIRE11124
Target Protein Information
| Protein_Name | Programmed cell death 1 ligand 1 |
|---|---|
| Protein_Sequence | MRIFAVFIFMTYWHLLNAFTVTVPKDLYVVEYGSNMTIECKFPVEKQLDLAALIVYWEMEDKNIIQFVHGEEDLKVQHSSYRQRARLLKDQLSLGNAALQITDVKLQDAGVYRCMISYGGADYKRITVKVNAPYNKINQRILVVDPVTSEHELTCQAEGYPKAEVIWTSSDHQVLSGKTTTTNSKREEKLFNVTSTLRINTTTNEIFYCTFRRLDPEENHTAELVIPELPLAHPPNERTHLVILGAILLCLGVALTFIFRLRKGRMMDVKKCGIQDTNSKKQSDTHLEET |
| Organism_Source | Homo sapiens |
| Functional_Classification | immune checkpoint receptors |
| Cellular_Localization | Plasma membrane |
| Gene_Names | CD274 |
| UniProt_ID | Q9NZQ7 |
| Protein-Protein Interaction Networks | |
Peptide Basic Information
| Peptide_Name | IMB-P6-10 |
|---|---|
| Peptide_Sequence | LTCSLAPNIASQL |
| Peptide_Length | 13 |
| Peptide_SMILES | CC[C@H](C)[C@H](NC(=O)[C@H](CC(N)=O)NC(=O)[C@@H]1CCCN1C(=O)[C@H](C)NC(=O)[C@H](CC(C)C)NC(=O)[C@H](CO)NC(=O)[C@H](CS)NC(=O)[C@@H](NC(=O)[C@@H](N)CC(C)C)[C@@H](C)O)C(=O)N[C@@H](C)C(=O)N[C@@H](CO)C(=O)N[C@@H](CCC(N)=O)C(=O)N[C@@H](CC(C)C)C(=O)O |
| Chemical_Modification | |
| Cyclization_Method | |
| Linear/Cyclic | Linear |
| N-terminal_Modification | Free |
| C-terminal_Modification | Free |
| Amino_Acid_Distribution | |
|
|
|
Peptide Physicochemical
| Molecular_Weight | 1330.56 |
|---|---|
| Aliphatic_Index | 135.38462 |
| Aromaticity | 0.00000 |
| Average_Rotatable_Bonds | 3.15385 |
| Charge_at_pH_7 | -0.06399 |
| Isoelectric_Point | 5.92254 |
|---|---|
| Hydrogen_Bond_Acceptors | 20 |
| Hydrogen_Bond_Donors | 19 |
| Topological_Polar_Surface_Area | 550.60000 |
| X_logP_energy | -6.61760 |
Interaction Information
Reference Information
| Document_Type | Research Articles |
|---|---|
| Title | Discovery of hPRDX5-based peptide inhibitors blocking PD-1/PD-L1 interaction through in silico proteolysis and rational design. |
| Release_Year | 2019 |
| PMID | 31745591 |
| DOI | 10.1007/s00280-019-03995-z |