PPIRE11197
Target Protein Information
| Protein_Name | Interleukin-22 receptor subunit alpha-1 |
|---|---|
| Protein_Sequence | MRTLLTILTVGSLAAHAPEDPSDLLQHVKFQSSNFENILTWDSGPEGTPDTVYSIEYKTYGERDWVAKKGCQRITRKSCNLTVETGNLTELYYARVTAVSAGGRSATKMTDRFSSLQHTTLKPPDVTCISKVRSIQMIVHPTPTPIRAGDGHRLTLEDIFHDLFYHLELQVNRTYQMHLGGKQREYEFFGLTPDTEFLGTIMICVPTWAKESAPYMCRVKTLPDRTWTYSFSGAFLFSMGFLVAVLCYLSYRYVTKPPAPPNSLNVQRVLTFQPLRFIQEHVLIPVFDLSGPSSLAQPVQYSQIRVSGPREPAGAPQRHSLSEITYLGQPDISILQPSNVPPPQILSPLSYAPNAAPEVGPPSYAPQVTPEAQFPFYAPQAISKVQPSSYAPQATPDSWPPSYGVCMEGSGKDSPTGTLSSPKHLRPKGQLQKEPPAGSCMLGGLSLQEVTSLAMEESQEAKSLHQPLGICTDRTSDPNVLHSGEEGTPQYLKGQLPLLSSVQIEGHPMSLPLQPPSRPCSPSDQGPSPWGLLESLVCPKDEAKSPAPETSDLEQPTELDSLFRGLALTVQWES |
| Organism_Source | Homo sapiens |
| Functional_Classification | cytokine receptors |
| Cellular_Localization | Plasma membrane |
| Gene_Names | IL22RA1 |
| UniProt_ID | Q8N6P7 |
| Protein-Protein Interaction Networks | |
Peptide Basic Information
| Peptide_Name | preHA+HA-derived |
|---|---|
| Peptide_Sequence | RLDKSNFQQPYIT |
| Peptide_Length | 13 |
| Peptide_SMILES | CC[C@H](C)[C@H](NC(=O)[C@H](Cc1ccc(O)cc1)NC(=O)[C@@H]1CCCN1C(=O)[C@H](CCC(N)=O)NC(=O)[C@H](CCC(N)=O)NC(=O)[C@H](Cc1ccccc1)NC(=O)[C@H](CC(N)=O)NC(=O)[C@H](CO)NC(=O)[C@H](CCCCN)NC(=O)[C@H](CC(=O)O)NC(=O)[C@H](CC(C)C)NC(=O)[C@@H](N)CCCNC(=N)N)C(=O)N[C@H](C(=O)O)[C@@H](C)O |
| Chemical_Modification | None |
| Cyclization_Method | None |
| Linear/Cyclic | Linear |
| N-terminal_Modification | Acetyl |
| C-terminal_Modification | amide |
| Amino_Acid_Distribution | |
|
|
|
Peptide Physicochemical
| Molecular_Weight | 1609.80 |
|---|---|
| Aliphatic_Index | 60.00000 |
| Aromaticity | 0.15385 |
| Average_Rotatable_Bonds | 4.00000 |
| Charge_at_pH_7 | 0.99728 |
| Isoelectric_Point | 9.29736 |
|---|---|
| Hydrogen_Bond_Acceptors | 23 |
| Hydrogen_Bond_Donors | 24 |
| Topological_Polar_Surface_Area | 718.91000 |
| X_logP_energy | -7.34823 |
Interaction Information
| Affinity | KD=223 uM |
|---|---|
| Affinity_Assay | Surface plasmon resonance |
| PDB_ID | None |
| Type | Inhibitor |
| Structure | |
Reference Information
| Document_Type | Research Articles |
|---|---|
| Title | Characterization of linear mimetic peptides of Interleukin-22 from dissection of protein interfaces. |
| Release_Year | 2017 |
| PMID | 28479106 |
| DOI | 10.1016/j.biochi.2017.05.002 |